The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(3-((4-Isopropylbenzyl)carbamoyl)piperidin-1-yl)phenoxy)-2-methylpropanoic Acid ID: ALA4859575
PubChem CID: 156180039
Max Phase: Preclinical
Molecular Formula: C26H34N2O4
Molecular Weight: 438.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1ccc(CNC(=O)C2CCCN(c3cccc(OC(C)(C)C(=O)O)c3)C2)cc1
Standard InChI: InChI=1S/C26H34N2O4/c1-18(2)20-12-10-19(11-13-20)16-27-24(29)21-7-6-14-28(17-21)22-8-5-9-23(15-22)32-26(3,4)25(30)31/h5,8-13,15,18,21H,6-7,14,16-17H2,1-4H3,(H,27,29)(H,30,31)
Standard InChI Key: RWRLBVSCKJARNJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
28.2994 -4.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8931 -3.8597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4781 -4.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6092 -2.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6081 -3.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3234 -3.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0404 -3.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0376 -2.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3217 -2.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8982 -2.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8980 -1.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1833 -2.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7561 -3.8853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4705 -3.4697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1862 -3.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9006 -3.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1875 -4.7081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6162 -3.8809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8993 -2.6425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6137 -2.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3265 -3.4652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3252 -2.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0422 -3.8787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0393 -4.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7541 -5.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4695 -4.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4656 -3.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7502 -3.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1785 -3.4526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6086 -3.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3216 -3.8563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6044 -2.6204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 10 1 0
10 11 1 0
10 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 19 1 0
19 20 1 0
18 21 1 0
20 22 1 0
21 22 1 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
27 29 1 0
29 2 1 0
2 30 1 0
30 31 1 0
30 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.57Molecular Weight (Monoisotopic): 438.2519AlogP: 4.58#Rotatable Bonds: 8Polar Surface Area: 78.87Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.18CX Basic pKa: 4.55CX LogP: 4.21CX LogD: 1.80Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: -1.23
References 1. Wang Z, Zhang M, Luo W, Zhang Y, Ji H.. (2021) Discovery of 2-(3-(3-Carbamoylpiperidin-1-yl)phenoxy)acetic Acid Derivatives as Novel Small-Molecule Inhibitors of the β-Catenin/B-Cell Lymphoma 9 Protein-Protein Interaction., 64 (9.0): [PMID:33902288 ] [10.1021/acs.jmedchem.1c00046 ]