2-(3-(3-((4-Isopropylbenzyl)carbamoyl)piperidin-1-yl)phenoxy)-2-methylpropanoic Acid

ID: ALA4859575

PubChem CID: 156180039

Max Phase: Preclinical

Molecular Formula: C26H34N2O4

Molecular Weight: 438.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)c1ccc(CNC(=O)C2CCCN(c3cccc(OC(C)(C)C(=O)O)c3)C2)cc1

Standard InChI:  InChI=1S/C26H34N2O4/c1-18(2)20-12-10-19(11-13-20)16-27-24(29)21-7-6-14-28(17-21)22-8-5-9-23(15-22)32-26(3,4)25(30)31/h5,8-13,15,18,21H,6-7,14,16-17H2,1-4H3,(H,27,29)(H,30,31)

Standard InChI Key:  RWRLBVSCKJARNJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   28.2994   -4.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8931   -3.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4781   -4.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6092   -2.6450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6081   -3.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3234   -3.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0404   -3.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0376   -2.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3217   -2.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8982   -2.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8980   -1.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1833   -2.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7561   -3.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4705   -3.4697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1862   -3.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9006   -3.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1875   -4.7081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6162   -3.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8993   -2.6425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6137   -2.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3265   -3.4652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3252   -2.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0422   -3.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0393   -4.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7541   -5.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4695   -4.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4656   -3.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7502   -3.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1785   -3.4526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6086   -3.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3216   -3.8563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6044   -2.6204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
 10 11  1  0
 10 12  1  0
  7 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 19 20  1  0
 18 21  1  0
 20 22  1  0
 21 22  1  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 27 29  1  0
 29  2  1  0
  2 30  1  0
 30 31  1  0
 30 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4859575

    ---

Associated Targets(Human)

CTNNB1 Tchem beta-catenin-B-cell lymphoma 9 protein complex (525 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.57Molecular Weight (Monoisotopic): 438.2519AlogP: 4.58#Rotatable Bonds: 8
Polar Surface Area: 78.87Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.18CX Basic pKa: 4.55CX LogP: 4.21CX LogD: 1.80
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: -1.23

References

1. Wang Z, Zhang M, Luo W, Zhang Y, Ji H..  (2021)  Discovery of 2-(3-(3-Carbamoylpiperidin-1-yl)phenoxy)acetic Acid Derivatives as Novel Small-Molecule Inhibitors of the β-Catenin/B-Cell Lymphoma 9 Protein-Protein Interaction.,  64  (9.0): [PMID:33902288] [10.1021/acs.jmedchem.1c00046]

Source