The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6-chloro-2-(2-(1-(4-chlorophenyl)-3-(4-methoxyphenyl)-1H-pyrazol-4-yl)vinyl)quinolin-4-yl)(morpholino)methanone ID: ALA4859626
PubChem CID: 164617094
Max Phase: Preclinical
Molecular Formula: C32H26Cl2N4O3
Molecular Weight: 585.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nn(-c3ccc(Cl)cc3)cc2/C=C/c2cc(C(=O)N3CCOCC3)c3cc(Cl)ccc3n2)cc1
Standard InChI: InChI=1S/C32H26Cl2N4O3/c1-40-27-11-3-21(4-12-27)31-22(20-38(36-31)26-9-5-23(33)6-10-26)2-8-25-19-29(32(39)37-14-16-41-17-15-37)28-18-24(34)7-13-30(28)35-25/h2-13,18-20H,14-17H2,1H3/b8-2+
Standard InChI Key: UTIFXRVYZVJPBY-KRXBUXKQSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
24.9740 -13.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9728 -14.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6876 -14.7154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6858 -13.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4012 -13.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4020 -14.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1173 -14.7094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8324 -14.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8275 -13.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1116 -13.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5485 -14.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2541 -14.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9736 -14.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2594 -13.0628 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.1073 -12.2324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8195 -11.8161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3906 -11.8237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5315 -12.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2416 -11.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2415 -10.9894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5250 -10.5785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8086 -10.9929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0711 -15.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8801 -15.6678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2840 -14.9484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7245 -14.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8854 -13.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2247 -16.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6656 -13.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8266 -12.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2059 -11.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4216 -12.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2642 -12.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7459 -17.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0898 -17.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9122 -17.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3894 -17.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0427 -16.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2578 -18.6650 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.3658 -11.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1466 -10.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
12 11 2 0
12 13 1 0
1 14 1 0
10 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
13 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 13 1 0
26 27 1 0
24 28 1 0
27 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 27 1 0
28 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 28 1 0
36 39 1 0
31 40 1 0
40 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.49Molecular Weight (Monoisotopic): 584.1382AlogP: 7.05#Rotatable Bonds: 6Polar Surface Area: 69.48Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.71CX LogP: 6.95CX LogD: 6.95Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: -1.64
References 1. Ghanim AM, Rezq S, Ibrahim TS, Romero DG, Kothayer H.. (2021) Novel 1,2,4-triazine-quinoline hybrids: The privileged scaffolds as potent multi-target inhibitors of LPS-induced inflammatory response via dual COX-2 and 15-LOX inhibition., 219 [PMID:33892270 ] [10.1016/j.ejmech.2021.113457 ]