2-(4-bromophenyl)-N-(2,3-di(furan-2-yl)quinoxalin-6-yl)acetamide

ID: ALA4859710

PubChem CID: 57345161

Max Phase: Preclinical

Molecular Formula: C24H16BrN3O3

Molecular Weight: 474.31

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(Br)cc1)Nc1ccc2nc(-c3ccco3)c(-c3ccco3)nc2c1

Standard InChI:  InChI=1S/C24H16BrN3O3/c25-16-7-5-15(6-8-16)13-22(29)26-17-9-10-18-19(14-17)28-24(21-4-2-12-31-21)23(27-18)20-3-1-11-30-20/h1-12,14H,13H2,(H,26,29)

Standard InChI Key:  XWSYERRAPYFIJB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    2.9496   -9.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9484  -10.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6565  -10.4735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6547   -8.8361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3633   -9.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3640  -10.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0726  -10.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7808  -10.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7761   -9.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0670   -8.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4813   -8.8216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1915   -9.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8967   -8.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1965  -10.0430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6069   -9.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6075  -10.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3168  -10.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0230  -10.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0154   -9.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3055   -8.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2458   -8.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1601   -8.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3607   -7.8499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9523   -8.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4993   -9.1648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2408  -10.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4945  -10.1369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9472  -10.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3553  -11.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1547  -11.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7337  -10.4290    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
  1 21  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  2  0
  2 26  1  0
 18 31  1  0
M  END

Associated Targets(Human)

NFKB2 Tchem Nuclear factor NF-kappa-B complex (2307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.31Molecular Weight (Monoisotopic): 473.0375AlogP: 6.09#Rotatable Bonds: 5
Polar Surface Area: 81.16Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.62CX Basic pKa: CX LogP: 5.33CX LogD: 5.33
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: -1.38

References

1. Sagar S, Singh S, Mallareddy JR, Sonawane YA, Napoleon JV, Rana S, Contreras JI, Rajesh C, Ezell EL, Kizhake S, Garrison JC, Radhakrishnan P, Natarajan A..  (2021)  Structure activity relationship (SAR) study identifies a quinoxaline urea analog that modulates IKKβ phosphorylation for pancreatic cancer therapy.,  222  [PMID:34098465] [10.1016/j.ejmech.2021.113579]

Source