N-((1S,4S)-4-(2-((2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)amino)-5-methyl-7-oxopyrido[2,3-d]pyrimidin-8(7H)-yl)cyclohexyl)-1-naphthamide

ID: ALA4859914

PubChem CID: 164618021

Max Phase: Preclinical

Molecular Formula: C37H41N7O3

Molecular Weight: 631.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2c(C)cc(=O)n([C@H]3CC[C@@H](NC(=O)c4cccc5ccccc45)CC3)c2n1

Standard InChI:  InChI=1S/C37H41N7O3/c1-24-21-34(45)44(27-13-11-26(12-14-27)39-36(46)30-10-6-8-25-7-4-5-9-29(25)30)35-31(24)23-38-37(41-35)40-32-16-15-28(22-33(32)47-3)43-19-17-42(2)18-20-43/h4-10,15-16,21-23,26-27H,11-14,17-20H2,1-3H3,(H,39,46)(H,38,40,41)/t26-,27+

Standard InChI Key:  NBVXUPNQWNJNAB-MKPDMIMOSA-N

Molfile:  

 
     RDKit          2D

 47 53  0  0  0  0  0  0  0  0999 V2000
   22.9147  -16.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9214  -15.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6365  -15.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3490  -15.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3464  -16.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0589  -16.9141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0521  -17.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3372  -18.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6247  -17.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6272  -16.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1997  -16.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1930  -17.7242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4873  -16.4809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4939  -15.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7815  -15.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7840  -14.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4991  -14.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2115  -14.4243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2090  -15.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3657  -12.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0782  -13.1736    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7933  -12.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7958  -11.9378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0833  -11.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3683  -11.9303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5150  -11.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2274  -11.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2208  -12.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5057  -13.1811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9332  -13.1885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5175  -10.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6465  -13.1661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9341  -12.7520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2190  -13.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5066  -12.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5091  -11.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2283  -11.5088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9407  -11.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7966  -11.5013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0816  -11.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3691  -11.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3716  -10.6689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0908  -10.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8033  -10.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6592  -10.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2124  -13.9836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4973  -14.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 10  2  0
  5 10  1  0
  1 11  1  0
 11 12  2  0
 11 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 22 29  1  0
 23 26  1  0
 28 30  2  0
 26 31  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 33 38  2  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 39 44  1  0
 42 45  1  0
 36 39  1  0
 46 47  1  0
 34 46  1  0
 32 33  1  0
 20 32  1  0
 17 29  1  1
 14 13  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4859914

    ---

Associated Targets(Human)

TTK Tchem Dual specificity protein kinase TTK (2978 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 631.78Molecular Weight (Monoisotopic): 631.3271AlogP: 5.67#Rotatable Bonds: 7
Polar Surface Area: 104.62Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.84CX LogP: 5.32CX LogD: 4.74
Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.24Np Likeness Score: -1.27

References

1. Huang M, Huang Y, Guo J, Yu L, Chang Y, Wang X, Luo J, Huang Y, Tu Z, Lu X, Xu Y, Zhang Z, Zhang Z, Ding K..  (2021)  Pyrido[2, 3-d]pyrimidin-7(8H)-ones as new selective orally bioavailable Threonine Tyrosine Kinase (TTK) inhibitors.,  211  [PMID:33248853] [10.1016/j.ejmech.2020.113023]

Source