N-((3R,4R,5S,6R)-2,4,5-trihydroxy-6-(((2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yloxy)methyl)tetrahydro-2H-pyran-3-yl)acetamide

ID: ALA4859920

Cas Number: 50787-10-5

PubChem CID: 53356710

Product Number: G130932, Order Now?

Max Phase: Preclinical

Molecular Formula: C14H25NO11

Molecular Weight: 383.35

Molecule Type: Unknown

Associated Items:

This product is currently unavailable

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@H]1C(O)O[C@H](CO[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C14H25NO11/c1-4(17)15-7-10(20)9(19)6(25-13(7)23)3-24-14-12(22)11(21)8(18)5(2-16)26-14/h5-14,16,18-23H,2-3H2,1H3,(H,15,17)/t5-,6-,7-,8+,9-,10-,11+,12-,13?,14-/m1/s1

Standard InChI Key:  ACKXCNXSQYSCQN-CIWHICPZSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   24.0659  -13.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0670  -12.6012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3560  -12.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6397  -12.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6389  -13.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3545  -13.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3559  -14.6668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9237  -13.8369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3579  -11.3648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9262  -12.1857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6445  -10.9507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0720  -14.3070    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.4997  -15.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4997  -15.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2117  -16.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9238  -15.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9238  -15.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2117  -14.6540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6394  -14.6603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2117  -17.1289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7840  -14.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6376  -16.3092    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7858  -16.3092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7816  -13.8353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6364  -17.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3502  -17.5477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9213  -17.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  6
  5  8  1  1
  3  9  1  1
  4 10  1  1
  9 11  1  0
  1 12  1  6
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 15 20  1  1
 13 21  1  1
 16 22  1  6
 14 23  1  6
 21 24  1  0
 24  1  1  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

LGALS1 Tchem Galectin-1 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.35Molecular Weight (Monoisotopic): 383.1428AlogP: -5.25#Rotatable Bonds: 5
Polar Surface Area: 198.40Molecular Species: NEUTRALHBA: 11HBD: 8
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.46CX Basic pKa: CX LogP: -4.99CX LogD: -4.99
Aromatic Rings: Heavy Atoms: 26QED Weighted: 0.23Np Likeness Score: 2.00

References

1. Porciúncula-González C, Cagnoni AJ, Fontana C, Mariño KV, Saenz-Méndez P, Giacomini C, Irazoqui G..  (2021)  Structural insights in galectin-1-glycan recognition: Relevance of the glycosidic linkage and the N-acetylation pattern of sugar moieties.,  44  [PMID:34293617] [10.1016/j.bmc.2021.116309]

Source