N-Cyclopropyl-1-(3-((1-((4-methoxyphenyl)sulfonamido)-2-methyl-1-oxopropan-2-yl)oxy)phenyl)-N-(4-(thiophen-2-yl)benzyl)piperidine-3-carboxamide

ID: ALA4859967

PubChem CID: 164617144

Max Phase: Preclinical

Molecular Formula: C37H41N3O6S2

Molecular Weight: 687.88

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)NC(=O)C(C)(C)Oc2cccc(N3CCCC(C(=O)N(Cc4ccc(-c5cccs5)cc4)C4CC4)C3)c2)cc1

Standard InChI:  InChI=1S/C37H41N3O6S2/c1-37(2,36(42)38-48(43,44)33-19-17-31(45-3)18-20-33)46-32-9-4-8-30(23-32)39-21-5-7-28(25-39)35(41)40(29-15-16-29)24-26-11-13-27(14-12-26)34-10-6-22-47-34/h4,6,8-14,17-20,22-23,28-29H,5,7,15-16,21,24-25H2,1-3H3,(H,38,42)

Standard InChI Key:  XJFRRLGBXWJOBG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 48 53  0  0  0  0  0  0  0  0999 V2000
   41.0228  -27.0303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4380  -27.7444    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   41.8490  -27.0278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.7067  -28.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2997  -28.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8841  -28.8712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0017  -26.9430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0006  -27.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7171  -28.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4352  -27.7711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4323  -26.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7153  -26.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2896  -26.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1519  -28.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8674  -27.7689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5842  -28.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2997  -27.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5855  -29.0092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0164  -28.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2983  -26.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0138  -26.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7277  -27.7645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7265  -26.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4445  -28.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4416  -29.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1576  -29.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8740  -29.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8701  -28.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1536  -27.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5841  -27.7518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0163  -27.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7304  -28.1561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0121  -26.9183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8613  -26.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2713  -26.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4492  -26.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2035  -25.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3993  -25.5446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9883  -26.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5386  -26.8674    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.1543  -28.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1518  -28.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8673  -29.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5821  -28.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5771  -28.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8611  -27.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2959  -29.3818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.0060  -28.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  7 13  1  0
 10 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 17 20  1  0
 20 21  1  0
 19 22  1  0
 21 23  1  0
 22 23  1  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 28 30  1  0
 30  5  1  0
  5 31  1  0
 31 32  1  0
 31 33  2  0
 35 34  1  0
 36 35  1  0
 34 36  1  0
 15 34  1  0
 13 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 13  1  0
 32  2  1  0
  2 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
 45 46  2  0
 46 41  1  0
 44 47  1  0
 47 48  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4859967

    ---

Associated Targets(Human)

CTNNB1 Tchem beta-catenin-B-cell lymphoma 9 protein complex (525 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 687.88Molecular Weight (Monoisotopic): 687.2437AlogP: 6.49#Rotatable Bonds: 12
Polar Surface Area: 105.25Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.15CX Basic pKa: 3.55CX LogP: 6.02CX LogD: 5.58
Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.18Np Likeness Score: -1.65

References

1. Wang Z, Zhang M, Luo W, Zhang Y, Ji H..  (2021)  Discovery of 2-(3-(3-Carbamoylpiperidin-1-yl)phenoxy)acetic Acid Derivatives as Novel Small-Molecule Inhibitors of the β-Catenin/B-Cell Lymphoma 9 Protein-Protein Interaction.,  64  (9.0): [PMID:33902288] [10.1021/acs.jmedchem.1c00046]

Source