N-(Oxazol-2-yl)-4-(4-(trifluoromethoxy)phenyl)picolinamide

ID: ALA4859970

PubChem CID: 162429828

Max Phase: Preclinical

Molecular Formula: C16H10F3N3O3

Molecular Weight: 349.27

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ncco1)c1cc(-c2ccc(OC(F)(F)F)cc2)ccn1

Standard InChI:  InChI=1S/C16H10F3N3O3/c17-16(18,19)25-12-3-1-10(2-4-12)11-5-6-20-13(9-11)14(23)22-15-21-7-8-24-15/h1-9H,(H,21,22,23)

Standard InChI Key:  DTRHXPDFFBVEPQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   18.6784  -12.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6773  -13.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3853  -13.8124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0950  -13.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0922  -12.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3835  -12.1750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7983  -12.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5076  -12.5750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2137  -12.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9590  -12.4962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5035  -11.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0922  -11.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2936  -11.3537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7952  -11.3518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3851  -14.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6776  -15.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6770  -15.8516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3852  -16.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0953  -15.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0924  -15.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3860  -17.0784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6788  -17.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6797  -18.3050    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.9706  -17.0800    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.9658  -17.8915    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
  7 14  2  0
  3 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4859970

    ---

Associated Targets(non-human)

Clostridioides difficile (2968 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus aureus (210822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.27Molecular Weight (Monoisotopic): 349.0674AlogP: 3.89#Rotatable Bonds: 4
Polar Surface Area: 77.25Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.95CX Basic pKa: 0.50CX LogP: 3.94CX LogD: 3.94
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.77Np Likeness Score: -1.16

References

1. Speri E, Qian Y, Janardhanan J, Masitas C, Lastochkin E, De Benedetti S, Wang M, Schroeder VA, Wolter WR, Oliver AG, Fisher JF, Mobashery S, Chang M..  (2021)  Structure-Activity Relationship for the Picolinamide Antibacterials that Selectively Target Clostridioides difficile.,  12  (6.0): [PMID:34141083] [10.1021/acsmedchemlett.1c00135]

Source