2-(2,4-dimethoxyphenyl)-3,7-dihydroxy-8-(morpholinomethyl)-4H-chromen-4-one

ID: ALA4860014

PubChem CID: 164613700

Max Phase: Preclinical

Molecular Formula: C22H23NO7

Molecular Weight: 413.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2oc3c(CN4CCOCC4)c(O)ccc3c(=O)c2O)c(OC)c1

Standard InChI:  InChI=1S/C22H23NO7/c1-27-13-3-4-14(18(11-13)28-2)22-20(26)19(25)15-5-6-17(24)16(21(15)30-22)12-23-7-9-29-10-8-23/h3-6,11,24,26H,7-10,12H2,1-2H3

Standard InChI Key:  XVUWPENZZBTFOO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   22.6901   -5.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6889   -6.1478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3970   -6.5567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3952   -4.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9823   -4.9198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3928   -4.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6838   -3.6957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1038   -5.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1027   -6.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8089   -6.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5207   -6.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5219   -5.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8112   -4.9130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8066   -7.3715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2273   -6.5578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2287   -4.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9357   -5.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6440   -4.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6464   -4.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9347   -3.7003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2294   -4.1088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5215   -3.7005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5213   -2.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3545   -3.7026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0618   -4.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6840   -2.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9791   -2.4686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2702   -2.8758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2707   -3.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9801   -4.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  9  2  0
  8  4  2  0
  4  1  1  0
  1  5  1  0
  4  6  1  0
  6  7  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 10 14  2  0
 11 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 12 16  1  0
 21 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  1  0
  7 26  1  0
  7 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860014

    ---

Associated Targets(Human)

RPMI-8226 (44974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.43Molecular Weight (Monoisotopic): 413.1475AlogP: 2.72#Rotatable Bonds: 5
Polar Surface Area: 101.60Molecular Species: ACIDHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 5.00CX Basic pKa: 6.04CX LogP: 1.07CX LogD: 0.15
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: 0.10

References

1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P..  (2021)  Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment.,  64  (20.0): [PMID:34644502] [10.1021/acs.jmedchem.1c00087]

Source