The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-dimethoxyphenyl)-3,7-dihydroxy-8-(morpholinomethyl)-4H-chromen-4-one ID: ALA4860014
PubChem CID: 164613700
Max Phase: Preclinical
Molecular Formula: C22H23NO7
Molecular Weight: 413.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2oc3c(CN4CCOCC4)c(O)ccc3c(=O)c2O)c(OC)c1
Standard InChI: InChI=1S/C22H23NO7/c1-27-13-3-4-14(18(11-13)28-2)22-20(26)19(25)15-5-6-17(24)16(21(15)30-22)12-23-7-9-29-10-8-23/h3-6,11,24,26H,7-10,12H2,1-2H3
Standard InChI Key: XVUWPENZZBTFOO-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
22.6901 -5.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6889 -6.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3970 -6.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3952 -4.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9823 -4.9198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3928 -4.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6838 -3.6957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1038 -5.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1027 -6.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8089 -6.5543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5207 -6.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5219 -5.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8112 -4.9130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8066 -7.3715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2273 -6.5578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2287 -4.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9357 -5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6440 -4.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6464 -4.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9347 -3.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2294 -4.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5215 -3.7005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5213 -2.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3545 -3.7026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0618 -4.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6840 -2.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9791 -2.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2702 -2.8758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2707 -3.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9801 -4.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 9 2 0
8 4 2 0
4 1 1 0
1 5 1 0
4 6 1 0
6 7 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
10 14 2 0
11 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
12 16 1 0
21 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
7 26 1 0
7 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.43Molecular Weight (Monoisotopic): 413.1475AlogP: 2.72#Rotatable Bonds: 5Polar Surface Area: 101.60Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.00CX Basic pKa: 6.04CX LogP: 1.07CX LogD: 0.15Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: 0.10
References 1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P.. (2021) Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment., 64 (20.0): [PMID:34644502 ] [10.1021/acs.jmedchem.1c00087 ]