Cochliomycin F

ID: ALA4860053

PubChem CID: 102136595

Max Phase: Preclinical

Molecular Formula: C19H22O7

Molecular Weight: 362.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)/C=C/C[C@@H](O)[C@@H](O)C(=O)/C=C/C[C@H](C)OC2=O

Standard InChI:  InChI=1S/C19H22O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h3-4,6-7,9-11,15,18,21-23H,5,8H2,1-2H3/b6-4+,7-3+/t11-,15+,18-/m0/s1

Standard InChI Key:  NEQZWEXWOFPKOT-ZFIAKDBVSA-N

Molfile:  

 
     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
    4.4849   -3.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4837   -4.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1918   -4.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1900   -2.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8986   -3.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8975   -4.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6037   -4.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6060   -2.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3167   -3.2300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3133   -4.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7313   -3.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0235   -2.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7279   -4.0546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0170   -4.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0097   -5.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7116   -5.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4225   -5.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4315   -4.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1876   -2.0055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7757   -4.4592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0683   -4.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7031   -6.5022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6060   -1.9992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0257   -2.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2977   -5.6699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1261   -5.6987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 10  2  0
  9  8  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 18  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  4 19  1  0
  2 20  1  0
 20 21  1  0
 16 22  1  6
  8 23  2  0
 12 24  1  1
 15 25  1  6
 17 26  2  0
M  END

Associated Targets(non-human)

Splenocyte (1641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.38Molecular Weight (Monoisotopic): 362.1366AlogP: 1.60#Rotatable Bonds: 1
Polar Surface Area: 113.29Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.59CX Basic pKa: CX LogP: 2.57CX LogD: 2.57
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.65Np Likeness Score: 2.01

References

1. Gao Y, Duan FF, Liu L, Peng XG, Meng XG, Ruan HL..  (2021)  Hypothemycin-Type Resorcylic Acid Lactones with Immunosuppressive Activities from a Podospora sp.,  84  (2.0): [PMID:33544615] [10.1021/acs.jnatprod.0c01344]

Source