The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cochliomycin F ID: ALA4860053
PubChem CID: 102136595
Max Phase: Preclinical
Molecular Formula: C19H22O7
Molecular Weight: 362.38
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c2c(c1)/C=C/C[C@@H](O)[C@@H](O)C(=O)/C=C/C[C@H](C)OC2=O
Standard InChI: InChI=1S/C19H22O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h3-4,6-7,9-11,15,18,21-23H,5,8H2,1-2H3/b6-4+,7-3+/t11-,15+,18-/m0/s1
Standard InChI Key: NEQZWEXWOFPKOT-ZFIAKDBVSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
4.4849 -3.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4837 -4.0511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1918 -4.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1900 -2.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8986 -3.2280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8975 -4.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6037 -4.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6060 -2.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3167 -3.2300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3133 -4.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7313 -3.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0235 -2.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7279 -4.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0170 -4.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0097 -5.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7116 -5.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4225 -5.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4315 -4.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1876 -2.0055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7757 -4.4592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0683 -4.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7031 -6.5022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6060 -1.9992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0257 -2.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2977 -5.6699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1261 -5.6987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 2 0
9 8 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 18 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
4 19 1 0
2 20 1 0
20 21 1 0
16 22 1 6
8 23 2 0
12 24 1 1
15 25 1 6
17 26 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 362.38Molecular Weight (Monoisotopic): 362.1366AlogP: 1.60#Rotatable Bonds: 1Polar Surface Area: 113.29Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.59CX Basic pKa: ┄CX LogP: 2.57CX LogD: 2.57Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.65Np Likeness Score: 2.01
References 1. Gao Y, Duan FF, Liu L, Peng XG, Meng XG, Ruan HL.. (2021) Hypothemycin-Type Resorcylic Acid Lactones with Immunosuppressive Activities from a Podospora sp., 84 (2.0): [PMID:33544615 ] [10.1021/acs.jnatprod.0c01344 ]