2-(3-Fluoro-2-hydroxyphenyl)-6-methyl-3-(2-phenylethyl)-5-(5-phenyl-2-thienyl)-4(3H)-pyrimidinone

ID: ALA4860070

PubChem CID: 136054392

Max Phase: Preclinical

Molecular Formula: C29H23FN2O2S

Molecular Weight: 482.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2cccc(F)c2O)n(CCc2ccccc2)c(=O)c1-c1ccc(-c2ccccc2)s1

Standard InChI:  InChI=1S/C29H23FN2O2S/c1-19-26(25-16-15-24(35-25)21-11-6-3-7-12-21)29(34)32(18-17-20-9-4-2-5-10-20)28(31-19)22-13-8-14-23(30)27(22)33/h2-16,33H,17-18H2,1H3

Standard InChI Key:  TUXVJNGWRQKZGH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   18.4184  -12.2908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4173  -13.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1294  -13.5235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8391  -13.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8363  -12.2872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1276  -11.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5481  -13.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5480  -14.3432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2596  -14.7547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9718  -14.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9679  -13.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2557  -13.1116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7051  -13.5225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1252  -11.0565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7064  -11.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6208  -11.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8173  -10.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4047  -11.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9559  -12.2157    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.5879  -11.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5466  -11.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2599  -12.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9702  -11.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6820  -12.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3918  -11.8653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3892  -11.0431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6708  -10.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9639  -11.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8364  -14.7563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2605  -15.5760    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.1095  -11.0245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2934  -11.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9564  -11.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4457  -12.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2601  -12.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4  7  1  0
  2 13  1  0
  6 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
  1 15  1  0
 18 20  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  8 29  1  0
  9 30  1  0
 20 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860070

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.58Molecular Weight (Monoisotopic): 482.1464AlogP: 6.70#Rotatable Bonds: 6
Polar Surface Area: 55.12Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.70CX Basic pKa: CX LogP: 6.85CX LogD: 6.67
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -0.74

References

1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW..  (2021)  Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction.,  12  (9.0): [PMID:34531948] [10.1021/acsmedchemlett.1c00187]

Source