3-((2-chloro-4-(trifluoromethyl)phenoxy)methyl)-N-phenylbenzamide

ID: ALA4860115

PubChem CID: 155154021

Max Phase: Preclinical

Molecular Formula: C21H15ClF3NO2

Molecular Weight: 405.80

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccccc1)c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1

Standard InChI:  InChI=1S/C21H15ClF3NO2/c22-18-12-16(21(23,24)25)9-10-19(18)28-13-14-5-4-6-15(11-14)20(27)26-17-7-2-1-3-8-17/h1-12H,13H2,(H,26,27)

Standard InChI Key:  MMPLAVIITNNMJR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   28.9428  -10.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9417  -10.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6497  -11.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3594  -10.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3566  -10.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6479   -9.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0627   -9.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7720   -9.9954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4781   -9.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1858   -9.9935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8915   -9.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8888   -8.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1746   -8.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4719   -8.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7611   -8.3689    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.5945   -8.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3042   -8.7576    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.5903   -7.5355    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.3002   -7.9367    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.2350   -9.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2348   -8.7787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5274  -10.0047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8196   -9.5963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8231   -8.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1161   -8.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4075   -8.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4103   -9.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1179  -10.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 12 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
  1 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860115

    ---

Associated Targets(Human)

MRGPRX4 Tchem Mas-related G-protein coupled receptor member X4 (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.80Molecular Weight (Monoisotopic): 405.0743AlogP: 6.19#Rotatable Bonds: 5
Polar Surface Area: 38.33Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.11CX LogD: 6.11
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.55Np Likeness Score: -1.62

References

1.  (2020)  Modulators of mas-related g-protein receptor x4 and related products and methods, 

Source