(2S,3S)-1-(4-(2H-tetrazol-5-yl)benzyl)-3-((3,5-dichlorobenzyl)oxy)-2-phenylpiperidine

ID: ALA4860118

PubChem CID: 164618062

Max Phase: Preclinical

Molecular Formula: C26H25Cl2N5O

Molecular Weight: 494.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Clc1cc(Cl)cc(CO[C@H]2CCCN(Cc3ccc(-c4nn[nH]n4)cc3)[C@H]2c2ccccc2)c1

Standard InChI:  InChI=1S/C26H25Cl2N5O/c27-22-13-19(14-23(28)15-22)17-34-24-7-4-12-33(25(24)20-5-2-1-3-6-20)16-18-8-10-21(11-9-18)26-29-31-32-30-26/h1-3,5-6,8-11,13-15,24-25H,4,7,12,16-17H2,(H,29,30,31,32)/t24-,25-/m0/s1

Standard InChI Key:  QENUKLQKXSDNOM-DQEYMECFSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   27.4213   -3.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4213   -3.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1266   -4.3996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8319   -3.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8319   -3.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1266   -2.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5408   -2.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5390   -4.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5346   -5.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2409   -5.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9502   -5.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9488   -4.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2419   -3.9967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5432   -1.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2521   -1.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9583   -1.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6668   -1.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6696   -0.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9581   -0.3264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2526   -0.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9576    0.4915    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.3731   -1.9660    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.1266   -5.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4189   -5.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7125   -5.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0052   -5.6203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0048   -6.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7175   -6.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4218   -6.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2992   -6.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5522   -6.5183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0062   -7.1263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4157   -7.8335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2148   -7.6624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  6
  4  8  1  6
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  7 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 17 22  1  0
  3 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 30 31  2  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 30  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860118

    ---

Associated Targets(Human)

PRKG1 Tchem cGMP-dependent protein kinase 1 beta (2814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.43Molecular Weight (Monoisotopic): 493.1436AlogP: 6.10#Rotatable Bonds: 7
Polar Surface Area: 66.93Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.37CX Basic pKa: 8.03CX LogP: 5.32CX LogD: 5.46
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.00

References

1. Hanisak J, Soriano A, Adam GC, Basso A, Bauman D, Bell D, Frank E, O'Donnell G, Tawa P, Verras A, Yu Y, Zhang L, Seganish WM..  (2021)  Discovery of the First Non-cGMP Mimetic Small Molecule Activators of cGMP-Dependent Protein Kinase 1 α (PKG1α).,  12  (8.0): [PMID:34413956] [10.1021/acsmedchemlett.1c00264]

Source