The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(3-(Cyclopropyl(4-(furan-2-yl)benzyl)carbamoyl)piperidin-1-yl)phenoxy)-2-methylpropanoic Acid ID: ALA4860163
PubChem CID: 156180019
Max Phase: Preclinical
Molecular Formula: C30H34N2O5
Molecular Weight: 502.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(Oc1cccc(N2CCCC(C(=O)N(Cc3ccc(-c4ccco4)cc3)C3CC3)C2)c1)C(=O)O
Standard InChI: InChI=1S/C30H34N2O5/c1-30(2,29(34)35)37-26-8-3-7-25(18-26)31-16-4-6-23(20-31)28(33)32(24-14-15-24)19-21-10-12-22(13-11-21)27-9-5-17-36-27/h3,5,7-13,17-18,23-24H,4,6,14-16,19-20H2,1-2H3,(H,34,35)
Standard InChI Key: RHMWPBQXMGTTNW-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
28.9503 -4.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5434 -3.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1278 -4.4072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2448 -2.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2436 -3.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9601 -3.7232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6783 -3.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6755 -2.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9583 -2.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5327 -2.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3951 -3.7212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1107 -3.3049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8274 -3.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5429 -3.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8287 -4.5453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2598 -3.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5417 -2.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2573 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9712 -3.3004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9699 -2.4741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6880 -3.7146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6851 -4.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4010 -4.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1176 -4.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1137 -3.7066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3970 -3.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8277 -3.2878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2601 -3.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9741 -3.6922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2558 -2.4543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1046 -2.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5146 -1.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6924 -1.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4510 -1.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6467 -1.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2359 -1.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7862 -2.4028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
14 17 1 0
17 18 1 0
16 19 1 0
18 20 1 0
19 20 1 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
25 27 1 0
27 2 1 0
2 28 1 0
28 29 1 0
28 30 2 0
32 31 1 0
33 32 1 0
31 33 1 0
12 31 1 0
10 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 10 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.61Molecular Weight (Monoisotopic): 502.2468AlogP: 5.60#Rotatable Bonds: 9Polar Surface Area: 83.22Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.18CX Basic pKa: 4.55CX LogP: 4.36CX LogD: 1.95Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -1.43
References 1. Wang Z, Zhang M, Luo W, Zhang Y, Ji H.. (2021) Discovery of 2-(3-(3-Carbamoylpiperidin-1-yl)phenoxy)acetic Acid Derivatives as Novel Small-Molecule Inhibitors of the β-Catenin/B-Cell Lymphoma 9 Protein-Protein Interaction., 64 (9.0): [PMID:33902288 ] [10.1021/acs.jmedchem.1c00046 ]