3-(5-(3-(Methylsulfonyl)phenyl)imidazo[2,1-b]thiazol-6-yl)phenol

ID: ALA4860208

PubChem CID: 162421456

Max Phase: Preclinical

Molecular Formula: C18H14N2O3S2

Molecular Weight: 370.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)c1cccc(-c2c(-c3cccc(O)c3)nc3sccn23)c1

Standard InChI:  InChI=1S/C18H14N2O3S2/c1-25(22,23)15-7-3-5-13(11-15)17-16(12-4-2-6-14(21)10-12)19-18-20(17)8-9-24-18/h2-11,21H,1H3

Standard InChI Key:  BPCPNNHGXWZUIA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   18.4191  -10.6907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7066  -11.1073    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.4237  -11.5159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6815   -6.9747    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.8969   -7.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8969   -8.0566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6815   -8.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1661   -7.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1123   -6.9747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6276   -7.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1123   -8.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1554  -10.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4124   -9.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8594   -9.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0493   -9.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7963  -10.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3494  -10.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8027   -7.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3902   -8.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5653   -8.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1528   -7.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5653   -6.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3902   -6.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1528   -9.0716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4516  -11.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  4  8  1  0
  9 10  1  0
 10 11  2  0
  5  9  2  0
  6 11  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 11 14  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 20 24  1  0
 10 18  1  0
 12  2  1  0
  2 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860208

    ---

Associated Targets(Human)

Panel NCI-60 (60 carcinoma cell lines) (1088 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 370.46Molecular Weight (Monoisotopic): 370.0446AlogP: 3.84#Rotatable Bonds: 3
Polar Surface Area: 71.67Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.56CX Basic pKa: 3.26CX LogP: 2.93CX LogD: 2.93
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.59Np Likeness Score: -1.60

References

1. Zaraei SO, Sbenati RM, Alach NN, Anbar HS, El-Gamal R, Tarazi H, Shehata MK, Abdel-Maksoud MS, Oh CH, El-Gamal MI..  (2021)  Discovery of first-in-class imidazothiazole-based potent and selective ErbB4 (HER4) kinase inhibitors.,  224  [PMID:34237622] [10.1016/j.ejmech.2021.113674]

Source