(2R,3R,3aS,6S,6aR)-6-(2-amino-3-fluoroquinolin-7-yloxy)-2-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-7-yl)hexahydro-2H-cyclopenta[b]furan-3,3a-diol

ID: ALA4860414

PubChem CID: 146346365

Max Phase: Preclinical

Molecular Formula: C22H21FN6O4

Molecular Weight: 452.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1nc2cc(O[C@H]3CC[C@@]4(O)[C@@H]3O[C@@H](n3ccc5c(N)ncnc53)[C@@H]4O)ccc2cc1F

Standard InChI:  InChI=1S/C22H21FN6O4/c23-13-7-10-1-2-11(8-14(10)28-19(13)25)32-15-3-5-22(31)16(30)21(33-17(15)22)29-6-4-12-18(24)26-9-27-20(12)29/h1-2,4,6-9,15-17,21,30-31H,3,5H2,(H2,25,28)(H2,24,26,27)/t15-,16-,17+,21+,22-/m0/s1

Standard InChI Key:  OPJSGLVCNKYGAA-OKLJIELZSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   29.4662   -3.0279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2760   -1.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4931   -2.2123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7371   -2.6588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2363   -3.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5412   -4.0518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3465   -4.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8462   -3.5183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5386   -2.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0389   -2.1227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.7914   -3.4888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0271   -3.2123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7728   -4.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9887   -4.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5334   -3.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7513   -4.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7234   -4.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4881   -5.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4213   -4.8013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3912   -5.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1071   -3.5816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3496   -3.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7066   -3.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9496   -3.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2393   -4.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4849   -5.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8392   -4.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0810   -4.8036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9674   -5.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6180   -6.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3736   -5.8095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2104   -5.9231    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.5079   -6.9288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3181   -3.0665    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  1  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 11  1  1  1
 11 12  1  0
 12 15  1  0
 14 13  1  0
 13 11  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
 13 19  1  6
 14 20  1  6
 16 21  1  6
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 27  2  0
 26 25  2  0
 25 22  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 30 33  1  0
 15 34  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4860414

    ---

Associated Targets(Human)

PRMT5 Tchem Protein arginine N-methyltransferase 5 (1273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Z-138 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.45Molecular Weight (Monoisotopic): 452.1608AlogP: 1.51#Rotatable Bonds: 3
Polar Surface Area: 154.56Molecular Species: NEUTRALHBA: 10HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.25CX Basic pKa: 7.51CX LogP: 1.51CX LogD: 1.46
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: 0.53

References

1. Quiroz RV, Reutershan MH, Schneider SE, Sloman D, Lacey BM, Swalm BM, Yeung CS, Gibeau C, Spellman DS, Rankic DA, Chen D, Witter D, Linn D, Munsell E, Feng G, Xu H, Hughes JME, Lim J, Saurí J, Geddes K, Wan M, Mansueto MS, Follmer NE, Fier PS, Siliphaivanh P, Daublain P, Palte RL, Hayes RP, Lee S, Kawamura S, Silverman S, Sanyal S, Henderson TJ, Ye Y, Gao Y, Nicholson B, Machacek MR..  (2021)  The Discovery of Two Novel Classes of 5,5-Bicyclic Nucleoside-Derived PRMT5 Inhibitors for the Treatment of Cancer.,  64  (7.0): [PMID:33755451] [10.1021/acs.jmedchem.0c02083]

Source