3-((4-phenoxyphenoxy)methyl)benzoic acid

ID: ALA4860466

PubChem CID: 22680123

Max Phase: Preclinical

Molecular Formula: C20H16O4

Molecular Weight: 320.34

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cccc(COc2ccc(Oc3ccccc3)cc2)c1

Standard InChI:  InChI=1S/C20H16O4/c21-20(22)16-6-4-5-15(13-16)14-23-17-9-11-19(12-10-17)24-18-7-2-1-3-8-18/h1-13H,14H2,(H,21,22)

Standard InChI Key:  QSWRRFFOGWDKKI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   38.8482  -16.3438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8470  -17.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5551  -17.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2647  -17.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2619  -16.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5533  -15.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1404  -15.9354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1402  -15.1182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4328  -16.3441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.9681  -15.9289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6773  -16.3349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.3835  -15.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0912  -16.3329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7968  -15.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7942  -15.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0800  -14.6985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3772  -15.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4998  -14.6921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.2096  -15.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2111  -15.9115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.9200  -16.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6266  -15.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6198  -15.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.9103  -14.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
M  END

Alternative Forms

Associated Targets(Human)

MRGPRX4 Tchem Mas-related G-protein coupled receptor member X4 (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 320.34Molecular Weight (Monoisotopic): 320.1049AlogP: 4.76#Rotatable Bonds: 6
Polar Surface Area: 55.76Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.02CX Basic pKa: CX LogP: 4.70CX LogD: 1.55
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.71Np Likeness Score: -0.51

References

1.  (2020)  Modulators of mas-related g-protein receptor x4 and related products and methods, 

Source