The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Penicisteckin E ID: ALA4860472
PubChem CID: 164618162
Max Phase: Preclinical
Molecular Formula: C22H26O7
Molecular Weight: 402.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC1=C(c2c(O)cc(OC)c3c2C[C@H](C)OC3)C(=O)C(C)=C(C[C@@H](C)O)C1=O
Standard InChI: InChI=1S/C22H26O7/c1-10(23)6-13-12(3)20(25)19(22(28-5)21(13)26)18-14-7-11(2)29-9-15(14)17(27-4)8-16(18)24/h8,10-11,23-24H,6-7,9H2,1-5H3/t10-,11+/m1/s1
Standard InChI Key: NLHRENKJECMDAE-MNOVXSKESA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
11.1115 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5416 -9.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5387 -8.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8233 -8.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8251 -9.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1134 -9.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4036 -9.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3995 -10.4949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1112 -10.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8272 -10.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2567 -9.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2537 -10.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9648 -10.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6811 -10.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6818 -9.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9662 -9.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9648 -8.4355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6785 -8.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3970 -9.2652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5383 -10.9122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9629 -11.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3946 -10.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3928 -11.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1064 -12.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6774 -12.1525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1086 -11.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2517 -8.0189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3961 -8.0267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3943 -7.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 2 0
5 2 2 0
2 3 1 0
3 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
2 11 1 0
11 12 1 0
11 16 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
15 19 2 0
12 20 2 0
13 21 1 0
14 22 1 0
22 23 1 0
23 24 1 0
23 25 1 1
9 26 1 6
3 27 1 0
1 28 1 0
28 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.44Molecular Weight (Monoisotopic): 402.1679AlogP: 2.46#Rotatable Bonds: 5Polar Surface Area: 102.29Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.09CX Basic pKa: ┄CX LogP: 2.37CX LogD: 2.29Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.73Np Likeness Score: 2.00
References 1. Wu XZ, Huang WJ, Liu W, Mándi A, Zhang Q, Zhang L, Zhang W, Kurtán T, Yuan CS, Zhang C.. (2021) Penicisteckins A-F, Isochroman-Derived Atropisomeric Dimers from Penicillium steckii HNNU-5B18., 84 (11.0): [PMID:34787427 ] [10.1021/acs.jnatprod.1c00787 ] 2. Wu XZ, Huang WJ, Liu W, Mándi A, Zhang Q, Zhang L, Zhang W, Kurtán T, Yuan CS, Zhang C.. (2021) Penicisteckins A-F, Isochroman-Derived Atropisomeric Dimers from Penicillium steckii HNNU-5B18., 84 (11.0): [PMID:34787427 ] [10.1021/acs.jnatprod.1c00787 ]