Penicisteckin E

ID: ALA4860472

PubChem CID: 164618162

Max Phase: Preclinical

Molecular Formula: C22H26O7

Molecular Weight: 402.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC1=C(c2c(O)cc(OC)c3c2C[C@H](C)OC3)C(=O)C(C)=C(C[C@@H](C)O)C1=O

Standard InChI:  InChI=1S/C22H26O7/c1-10(23)6-13-12(3)20(25)19(22(28-5)21(13)26)18-14-7-11(2)29-9-15(14)17(27-4)8-16(18)24/h8,10-11,23-24H,6-7,9H2,1-5H3/t10-,11+/m1/s1

Standard InChI Key:  NLHRENKJECMDAE-MNOVXSKESA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   11.1115   -8.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5416   -9.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5387   -8.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8233   -8.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8251   -9.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1134   -9.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4036   -9.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3995  -10.4949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1112  -10.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8272  -10.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2567   -9.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2537  -10.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9648  -10.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6811  -10.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6818   -9.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9662   -9.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9648   -8.4355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6785   -8.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3970   -9.2652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5383  -10.9122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9629  -11.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3946  -10.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3928  -11.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1064  -12.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6774  -12.1525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1086  -11.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2517   -8.0189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3961   -8.0267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3943   -7.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  2 11  1  0
 11 12  1  0
 11 16  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 15 19  2  0
 12 20  2  0
 13 21  1  0
 14 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  1
  9 26  1  6
  3 27  1  0
  1 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860472

    ---

Associated Targets(Human)

HGC-27 (1452 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SH-SY5Y (11521 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

C6 (2371 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.44Molecular Weight (Monoisotopic): 402.1679AlogP: 2.46#Rotatable Bonds: 5
Polar Surface Area: 102.29Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.09CX Basic pKa: CX LogP: 2.37CX LogD: 2.29
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.73Np Likeness Score: 2.00

References

1. Wu XZ, Huang WJ, Liu W, Mándi A, Zhang Q, Zhang L, Zhang W, Kurtán T, Yuan CS, Zhang C..  (2021)  Penicisteckins A-F, Isochroman-Derived Atropisomeric Dimers from Penicillium steckii HNNU-5B18.,  84  (11.0): [PMID:34787427] [10.1021/acs.jnatprod.1c00787]
2. Wu XZ, Huang WJ, Liu W, Mándi A, Zhang Q, Zhang L, Zhang W, Kurtán T, Yuan CS, Zhang C..  (2021)  Penicisteckins A-F, Isochroman-Derived Atropisomeric Dimers from Penicillium steckii HNNU-5B18.,  84  (11.0): [PMID:34787427] [10.1021/acs.jnatprod.1c00787]

Source