(S)-4-(2-(2-(3-cyanophenyl)-1-hydroxy-4-methyl-1H-imidazole-5-carboxamido)-3-phenylpropanamido)benzoic acid

ID: ALA4860514

PubChem CID: 164616045

Max Phase: Preclinical

Molecular Formula: C28H23N5O5

Molecular Weight: 509.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2cccc(C#N)c2)n(O)c1C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C28H23N5O5/c1-17-24(33(38)25(30-17)21-9-5-8-19(14-21)16-29)27(35)32-23(15-18-6-3-2-4-7-18)26(34)31-22-12-10-20(11-13-22)28(36)37/h2-14,23,38H,15H2,1H3,(H,31,34)(H,32,35)(H,36,37)/t23-/m0/s1

Standard InChI Key:  LRNZBNKGAAZXIU-QHCPKHFHSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   40.0424   -3.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7501   -2.8767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4578   -3.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4553   -4.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1621   -4.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8708   -4.1034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8682   -3.2820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1607   -2.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5791   -4.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5802   -5.3282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2862   -4.1015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3347   -2.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6270   -3.2853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9192   -2.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0424   -4.1025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3347   -2.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0424   -1.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7496   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4569   -1.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4573   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7446   -0.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0403   -0.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9192   -2.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2115   -3.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4636   -2.9573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9168   -3.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3255   -4.2723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1247   -4.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7318   -4.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2915   -2.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1089   -3.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7773   -2.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9654   -2.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4842   -3.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8207   -4.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6316   -4.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3481   -4.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8701   -5.3841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
  9 11  1  0
  1 12  1  0
 12 13  1  0
 13 14  1  0
  1 15  2  0
 12 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 14 23  2  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  2  0
 28 29  1  0
 25 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 26 31  1  0
 37 38  3  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860514

    ---

Associated Targets(Human)

F11 Tchem Coagulation factor XI (1733 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.52Molecular Weight (Monoisotopic): 509.1699AlogP: 3.65#Rotatable Bonds: 8
Polar Surface Area: 157.34Molecular Species: ACIDHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.18CX Basic pKa: 2.76CX LogP: 2.76CX LogD: -0.08
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.13

References

1. Lei Y, Zhang B, Zhang Y, Dai X, Duan Y, Mao Q, Gao J, Yang Y, Bao Z, Fu X, Ping K, Yan C, Mou Y, Wang S..  (2021)  Design, synthesis and biological evaluation of novel FXIa inhibitors with 2-phenyl-1H-imidazole-5-carboxamide moiety as P1 fragment.,  220  [PMID:33894565] [10.1016/j.ejmech.2021.113437]

Source