2-(4-(4-(1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)vinyl)phenoxy)phenoxy)ethanol

ID: ALA4860640

PubChem CID: 44232573

Max Phase: Preclinical

Molecular Formula: C24H28O6

Molecular Weight: 412.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc(Oc2ccc(OCCO)cc2)cc1)C1COC2(CCCCC2)OO1

Standard InChI:  InChI=1S/C24H28O6/c1-18(23-17-27-24(30-29-23)13-3-2-4-14-24)19-5-7-21(8-6-19)28-22-11-9-20(10-12-22)26-16-15-25/h5-12,23,25H,1-4,13-17H2

Standard InChI Key:  CYJUBFMXLFPCKF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   38.9569   -7.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6627   -7.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3655   -7.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3687   -6.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6630   -5.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9540   -6.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0058   -6.7827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7160   -7.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7163   -8.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4257   -8.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1319   -7.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1242   -7.1736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4143   -6.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8426   -8.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8487   -9.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5473   -7.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2545   -8.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9570   -7.9801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2446   -6.7571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5359   -7.1691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3006   -7.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8933   -8.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6085   -8.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3103   -8.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8888   -7.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5951   -6.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1887   -8.4316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4779   -8.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7733   -8.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0626   -8.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 16 20  1  0
 17 18  1  0
 18  1  1  0
  1 19  1  0
 19 20  1  0
  7 21  1  0
 21 26  2  0
 25 22  2  0
 22 23  1  0
 23 24  2  0
 24 21  1  0
 25 26  1  0
 22 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Associated Targets(non-human)

Plasmodium yoelii (6656 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.48Molecular Weight (Monoisotopic): 412.1886AlogP: 4.87#Rotatable Bonds: 7
Polar Surface Area: 66.38Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.89CX LogD: 4.89
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: 0.42

References

1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V..  (2021)  Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis.,  49  [PMID:34365007] [10.1016/j.bmcl.2021.128305]

Source