The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,5-Dimethoxy-2-((E)-2-nitrovinyl)-3-((E)-4-((4-(trifluoromethyl)benzyl)oxy)styryl)benzene ID: ALA4860676
PubChem CID: 164614727
Max Phase: Preclinical
Molecular Formula: C26H22F3NO5
Molecular Weight: 485.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/c2ccc(OCc3ccc(C(F)(F)F)cc3)cc2)c(/C=C/[N+](=O)[O-])c(OC)c1
Standard InChI: InChI=1S/C26H22F3NO5/c1-33-23-15-20(24(13-14-30(31)32)25(16-23)34-2)8-3-18-6-11-22(12-7-18)35-17-19-4-9-21(10-5-19)26(27,28)29/h3-16H,17H2,1-2H3/b8-3+,14-13+
Standard InChI Key: LVURWJULIHEJAM-LTLKQSLSSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
21.1998 -13.9832 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.7915 -14.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6163 -14.6952 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.5068 -11.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5056 -11.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2205 -12.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9369 -11.8351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9340 -11.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2186 -10.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2162 -9.7705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5005 -9.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7908 -12.2475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0767 -11.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6520 -12.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3659 -11.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0809 -12.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0776 -13.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7918 -13.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5066 -13.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5027 -12.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7878 -11.8285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2223 -13.4757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9355 -13.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6512 -13.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6495 -14.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3642 -14.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0785 -14.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0734 -13.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3581 -13.0567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7982 -15.5269 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.6470 -10.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3629 -10.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0759 -10.5840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0735 -9.7579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7926 -10.9927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
5 12 1 0
12 13 1 0
7 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 2 1 0
2 30 1 0
8 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
33 35 1 0
M CHG 2 33 1 35 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.46Molecular Weight (Monoisotopic): 485.1450AlogP: 6.72#Rotatable Bonds: 9Polar Surface Area: 70.83Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.61CX LogD: 6.61Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.19Np Likeness Score: -0.28
References 1. Chen LZ, Zhang XX, Liu MM, Wu J, Ma D, Diao LZ, Li Q, Huang YS, Zhang R, Ruan BF, Liu XH.. (2021) Discovery of Novel Pterostilbene-Based Derivatives as Potent and Orally Active NLRP3 Inflammasome Inhibitors with Inflammatory Activity for Colitis., 64 (18.0): [PMID:34506712 ] [10.1021/acs.jmedchem.1c01007 ]