2-((E)-4-Hydroxystyryl)-1-methyl-4-((Z)-(3-(3-morpholinopropyl)benzo[d]thiazol-2(3H)-ylidene)methyl)quinolin-1-ium iodide

ID: ALA4860686

PubChem CID: 164616484

Max Phase: Preclinical

Molecular Formula: C33H34IN3O2S

Molecular Weight: 536.72

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[n+]1c(/C=C/c2ccc(O)cc2)cc(/C=C2\Sc3ccccc3N2CCCN2CCOCC2)c2ccccc21.[I-]

Standard InChI:  InChI=1S/C33H33N3O2S.HI/c1-34-27(14-11-25-12-15-28(37)16-13-25)23-26(29-7-2-3-8-30(29)34)24-33-36(31-9-4-5-10-32(31)39-33)18-6-17-35-19-21-38-22-20-35;/h2-5,7-16,23-24H,6,17-22H2,1H3;1H/b33-24-;

Standard InChI Key:  JHBBFUXYCSNXKH-CNDADNQXSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   14.0821   -7.0576    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   13.1232   -4.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1220   -5.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8301   -5.9748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8283   -4.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5410   -4.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5418   -5.5617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2545   -5.9688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9668   -5.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9621   -4.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2489   -4.3242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2445   -3.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9542   -3.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7038   -3.4186    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.0325   -2.2730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8350   -2.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2498   -2.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0697   -2.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4758   -2.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0601   -1.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2416   -1.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4172   -1.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6377   -1.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0265   -1.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2470   -1.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2501   -6.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6309   -1.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8542   -1.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6858   -2.2155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3005   -2.7601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0836   -2.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6756   -5.9647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6777   -6.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3865   -7.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3833   -8.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0912   -8.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7988   -7.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7940   -7.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0855   -6.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5081   -8.4057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 17  1  0
 16 15  1  0
 15 13  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 15 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  8 26  1  0
 25 27  1  0
 25 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
  9 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 37 40  1  0
M  CHG  2   1  -1   8   1
M  END

Associated Targets(Human)

quadruplex DNA (2700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.72Molecular Weight (Monoisotopic): 536.2366AlogP: 6.17#Rotatable Bonds: 7
Polar Surface Area: 39.82Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.93CX Basic pKa: 6.68CX LogP: 2.29CX LogD: 2.20
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -0.59

References

1. Long W, Zheng BX, Huang XH, She MT, Liu AL, Zhang K, Wong WL, Lu YJ..  (2021)  Molecular Recognition and Imaging of Human Telomeric G-Quadruplex DNA in Live Cells: A Systematic Advancement of Thiazole Orange Scaffold To Enhance Binding Specificity and Inhibition of Gene Expression.,  64  (4.0): [PMID:33559473] [10.1021/acs.jmedchem.0c01656]

Source