The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((E)-4-Hydroxystyryl)-1-methyl-4-((Z)-(3-(3-morpholinopropyl)benzo[d]thiazol-2(3H)-ylidene)methyl)quinolin-1-ium iodide ID: ALA4860686
PubChem CID: 164616484
Max Phase: Preclinical
Molecular Formula: C33H34IN3O2S
Molecular Weight: 536.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[n+]1c(/C=C/c2ccc(O)cc2)cc(/C=C2\Sc3ccccc3N2CCCN2CCOCC2)c2ccccc21.[I-]
Standard InChI: InChI=1S/C33H33N3O2S.HI/c1-34-27(14-11-25-12-15-28(37)16-13-25)23-26(29-7-2-3-8-30(29)34)24-33-36(31-9-4-5-10-32(31)39-33)18-6-17-35-19-21-38-22-20-35;/h2-5,7-16,23-24H,6,17-22H2,1H3;1H/b33-24-;
Standard InChI Key: JHBBFUXYCSNXKH-CNDADNQXSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
14.0821 -7.0576 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
13.1232 -4.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1220 -5.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8301 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8283 -4.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5410 -4.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5418 -5.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2545 -5.9688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9668 -5.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9621 -4.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2489 -4.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2445 -3.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9542 -3.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7038 -3.4186 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.0325 -2.2730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8350 -2.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2498 -2.8058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0697 -2.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4758 -2.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0601 -1.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2416 -1.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4172 -1.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6377 -1.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0265 -1.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2470 -1.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2501 -6.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6309 -1.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8542 -1.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6858 -2.2155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3005 -2.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0836 -2.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6756 -5.9647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6777 -6.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3865 -7.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3833 -8.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0912 -8.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7988 -7.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7940 -7.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0855 -6.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5081 -8.4057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 17 1 0
16 15 1 0
15 13 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
8 26 1 0
25 27 1 0
25 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
9 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
37 40 1 0
M CHG 2 1 -1 8 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.72Molecular Weight (Monoisotopic): 536.2366AlogP: 6.17#Rotatable Bonds: 7Polar Surface Area: 39.82Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.93CX Basic pKa: 6.68CX LogP: 2.29CX LogD: 2.20Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -0.59
References 1. Long W, Zheng BX, Huang XH, She MT, Liu AL, Zhang K, Wong WL, Lu YJ.. (2021) Molecular Recognition and Imaging of Human Telomeric G-Quadruplex DNA in Live Cells: A Systematic Advancement of Thiazole Orange Scaffold To Enhance Binding Specificity and Inhibition of Gene Expression., 64 (4.0): [PMID:33559473 ] [10.1021/acs.jmedchem.0c01656 ]