(S)-4-(2-(6-ethoxypyridin-3-yl)hydrazinyl)-5-fluoro-N-(1-(5-fluoropyridin-2-yl)ethyl)quinazolin-2-amine

ID: ALA4860810

PubChem CID: 164616507

Max Phase: Preclinical

Molecular Formula: C22H20F2N6O

Molecular Weight: 422.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1ccc(Nc2nc(N[C@@H](C)c3ccc(F)cn3)nc3cccc(F)c23)cn1

Standard InChI:  InChI=1S/C22H20F2N6O/c1-3-31-19-10-8-15(12-26-19)28-21-20-16(24)5-4-6-18(20)29-22(30-21)27-13(2)17-9-7-14(23)11-25-17/h4-13H,3H2,1-2H3,(H2,27,28,29,30)/t13-/m0/s1

Standard InChI Key:  ILWNTKASMVFCPG-ZDUSSCGKSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   25.0793   -9.9589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7728   -9.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6539   -9.9518    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.0212  -13.6993    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.3595  -11.1902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6082  -12.0453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0736  -10.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0602  -12.4244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7716  -12.0224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1923  -12.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6385  -12.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9305  -12.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3139  -13.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3188  -12.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8989  -12.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7804  -11.1992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8890  -13.2687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5948  -13.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9333  -11.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3527  -12.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6481  -10.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1997  -11.2143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4783  -12.4371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4996   -9.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1923   -9.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1585   -8.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4261   -8.2619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7365   -8.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8479   -8.2033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5726   -8.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2620   -8.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  9 23  1  0
 21  3  1  0
 12 11  2  0
 17 18  1  0
 11 20  1  0
 14  6  2  0
  5 21  1  0
 13  4  1  0
 20  5  1  0
 10 15  1  0
 20  8  2  0
  7  5  2  0
  7  1  1  0
 16  7  1  0
 19 12  1  0
 15 17  2  0
 10 22  1  1
  9 16  2  0
 18 13  2  0
 23 10  1  0
  6 15  1  0
 21 19  2  0
 13 14  1  0
  8  9  1  0
  2 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28  2  1  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860810

    ---

Associated Targets(Human)

GRK6 Tchem G protein-coupled receptor kinase 6 (1545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 422.44Molecular Weight (Monoisotopic): 422.1667AlogP: 5.01#Rotatable Bonds: 7
Polar Surface Area: 84.85Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.39CX Basic pKa: 5.53CX LogP: 4.63CX LogD: 4.62
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.85

References

1. Uehling DE, Joseph B, Chung KC, Zhang AX, Ler S, Prakesch MA, Poda G, Grouleff J, Aman A, Kiyota T, Leung-Hagesteijn C, Konda JD, Marcellus R, Griffin C, Subramaniam R, Abibi A, Strathdee CA, Isaac MB, Al-Awar R, Tiedemann RE..  (2021)  Design, Synthesis, and Characterization of 4-Aminoquinazolines as Potent Inhibitors of the G Protein-Coupled Receptor Kinase 6 (GRK6) for the Treatment of Multiple Myeloma.,  64  (15.0): [PMID:34291633] [10.1021/acs.jmedchem.1c00506]
2. Tesmer, John J G JJ, Tesmer, Valerie M VM, Lodowski, David T DT, Steinhagen, Henning H and Huber, Jochen J.  2010-02-25  Structure of human G protein-coupled receptor kinase 2 in complex with the kinase inhibitor balanol.  [PMID:20128603]

Source