The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-(3-oxo-4-morpholinyl)phenyl]-4-(2-cyclopropyl-5-oxazolyl)benzenesulfonamide ID: ALA4860812
PubChem CID: 164616509
Max Phase: Preclinical
Molecular Formula: C22H21N3O5S
Molecular Weight: 439.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1COCCN1c1ccc(NS(=O)(=O)c2ccc(-c3cnc(C4CC4)o3)cc2)cc1
Standard InChI: InChI=1S/C22H21N3O5S/c26-21-14-29-12-11-25(21)18-7-5-17(6-8-18)24-31(27,28)19-9-3-15(4-10-19)20-13-23-22(30-20)16-1-2-16/h3-10,13,16,24H,1-2,11-12,14H2
Standard InChI Key: ICCUEFAWFDCIEZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
31.5031 -5.2911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0987 -4.5812 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.6856 -5.2885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8113 -3.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8101 -4.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5223 -4.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2361 -4.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2332 -3.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5205 -2.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9413 -2.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6932 -3.2635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2419 -2.6541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8265 -1.9438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0237 -2.1168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1605 -1.1928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8197 -0.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0678 -0.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3906 -4.1738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6783 -4.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9695 -4.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2578 -4.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2544 -5.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9687 -5.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6776 -5.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5458 -5.8024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8390 -5.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5440 -6.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8354 -7.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1286 -6.6165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1304 -5.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8408 -4.5751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 1 0
8 10 1 0
16 15 1 0
17 16 1 0
15 17 1 0
13 15 1 0
5 2 1 0
2 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 1 0
25 27 1 0
27 28 1 0
26 30 1 0
28 29 1 0
29 30 1 0
26 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.49Molecular Weight (Monoisotopic): 439.1202AlogP: 3.38#Rotatable Bonds: 6Polar Surface Area: 101.74Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.74CX Basic pKa: 1.16CX LogP: 1.63CX LogD: 1.49Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.63Np Likeness Score: -1.69
References 1. Sisco E, Barnes KL.. (2021) Design, Synthesis, and Biological Evaluation of Novel 1,3-Oxazole Sulfonamides as Tubulin Polymerization Inhibitors., 12 (6.0): [PMID:34141089 ] [10.1021/acsmedchemlett.1c00219 ]