N-[4-(3-oxo-4-morpholinyl)phenyl]-4-(2-cyclopropyl-5-oxazolyl)benzenesulfonamide

ID: ALA4860812

PubChem CID: 164616509

Max Phase: Preclinical

Molecular Formula: C22H21N3O5S

Molecular Weight: 439.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1COCCN1c1ccc(NS(=O)(=O)c2ccc(-c3cnc(C4CC4)o3)cc2)cc1

Standard InChI:  InChI=1S/C22H21N3O5S/c26-21-14-29-12-11-25(21)18-7-5-17(6-8-18)24-31(27,28)19-9-3-15(4-10-19)20-13-23-22(30-20)16-1-2-16/h3-10,13,16,24H,1-2,11-12,14H2

Standard InChI Key:  ICCUEFAWFDCIEZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   31.5031   -5.2911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0987   -4.5812    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.6856   -5.2885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8113   -3.3513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8101   -4.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5223   -4.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2361   -4.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2332   -3.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5205   -2.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9413   -2.9340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6932   -3.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2419   -2.6541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8265   -1.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0237   -2.1168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1605   -1.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8197   -0.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0678   -0.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3906   -4.1738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6783   -4.5817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9695   -4.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2578   -4.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2544   -5.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9687   -5.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6776   -5.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5458   -5.8024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8390   -5.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5440   -6.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8354   -7.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1286   -6.6165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1304   -5.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8408   -4.5751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  8 10  1  0
 16 15  1  0
 17 16  1  0
 15 17  1  0
 13 15  1  0
  5  2  1  0
  2 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 26 30  1  0
 28 29  1  0
 29 30  1  0
 26 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4860812

    ---

Associated Targets(Human)

Panel NCI-60 (60 carcinoma cell lines) (1088 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.49Molecular Weight (Monoisotopic): 439.1202AlogP: 3.38#Rotatable Bonds: 6
Polar Surface Area: 101.74Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.74CX Basic pKa: 1.16CX LogP: 1.63CX LogD: 1.49
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.63Np Likeness Score: -1.69

References

1. Sisco E, Barnes KL..  (2021)  Design, Synthesis, and Biological Evaluation of Novel 1,3-Oxazole Sulfonamides as Tubulin Polymerization Inhibitors.,  12  (6.0): [PMID:34141089] [10.1021/acsmedchemlett.1c00219]

Source