2,6-difluoro-4-(9-(4-phenoxyphenyl)-9H-purin-2-ylamino)phenol

ID: ALA4860957

PubChem CID: 164614775

Max Phase: Preclinical

Molecular Formula: C23H15F2N5O2

Molecular Weight: 431.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1c(F)cc(Nc2ncc3ncn(-c4ccc(Oc5ccccc5)cc4)c3n2)cc1F

Standard InChI:  InChI=1S/C23H15F2N5O2/c24-18-10-14(11-19(25)21(18)31)28-23-26-12-20-22(29-23)30(13-27-20)15-6-8-17(9-7-15)32-16-4-2-1-3-5-16/h1-13,31H,(H,26,28,29)

Standard InChI Key:  LMOJDDMTQLQPPD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   20.0483  -10.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0472  -11.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7620  -11.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4784  -11.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4755  -10.7503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7601  -10.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7577   -9.5163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.3338  -10.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3323  -11.9933    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.1935  -11.9923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9073  -11.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6191  -11.9904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6114  -10.3404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9011  -10.7558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3284  -10.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3352  -11.5736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1334  -11.8439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6064  -11.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1139  -10.4830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3953  -12.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8472  -13.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1087  -14.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9181  -14.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4653  -13.5654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2008  -12.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1813  -14.9704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6357  -15.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8290  -15.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2836  -16.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5467  -16.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3601  -16.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9019  -16.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  1  8  1  0
  2  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 16  1  0
 15 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 23 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4860957

    ---

Associated Targets(Human)

RPS6KA3 Tchem Ribosomal protein S6 kinase alpha 3 (4284 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.40Molecular Weight (Monoisotopic): 431.1194AlogP: 5.34#Rotatable Bonds: 5
Polar Surface Area: 85.09Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.28CX Basic pKa: 1.09CX LogP: 5.19CX LogD: 5.13
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.12

References

1. Casalvieri KA, Matheson CJ, Warfield BM, Backos DS, Reigan P..  (2021)  N-Substituted pyrrolopyrimidines and purines as p90 ribosomal S6 protein kinase-2 (RSK2) inhibitors.,  41  [PMID:34034149] [10.1016/j.bmc.2021.116220]

Source