2-(3-(5-(3-(Methylsulfonyl)phenyl)imidazo[2,1-b]thiazol-6-yl)phenoxy)-1-phenylethanone

ID: ALA4861028

PubChem CID: 164616567

Max Phase: Preclinical

Molecular Formula: C26H20N2O4S2

Molecular Weight: 488.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)c1cccc(-c2c(-c3cccc(OCC(=O)c4ccccc4)c3)nc3sccn23)c1

Standard InChI:  InChI=1S/C26H20N2O4S2/c1-34(30,31)22-12-6-10-20(16-22)25-24(27-26-28(25)13-14-33-26)19-9-5-11-21(15-19)32-17-23(29)18-7-3-2-4-8-18/h2-16H,17H2,1H3

Standard InChI Key:  WJWCZLZKTCWTCS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    9.9060  -28.2337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1930  -28.6506    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.9105  -29.0596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7316  -24.4372    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.9810  -24.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0658  -25.5936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8723  -25.7662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2851  -25.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1702  -24.6026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7575  -25.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3109  -25.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1384  -26.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7552  -27.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5828  -28.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7976  -28.3510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1850  -27.8018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3533  -26.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9388  -25.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6010  -26.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7824  -26.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2974  -25.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6311  -24.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4538  -24.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4443  -26.9988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6213  -26.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2063  -27.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0224  -29.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3808  -27.7113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6177  -28.4287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2001  -29.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6108  -29.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4371  -29.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8511  -29.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4381  -28.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  4  8  1  0
  9 10  1  0
 10 11  2  0
  5  9  2  0
  6 11  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 14  2  1  0
 11 12  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 25 26  1  0
 24 25  1  0
 20 24  1  0
 10 18  1  0
  2 27  1  0
 26 28  2  0
 26 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861028

    ---

Associated Targets(Human)

Panel NCI-60 (60 carcinoma cell lines) (1088 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.59Molecular Weight (Monoisotopic): 488.0864AlogP: 5.40#Rotatable Bonds: 7
Polar Surface Area: 77.74Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.26CX LogP: 4.31CX LogD: 4.31
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -1.75

References

1. Zaraei SO, Sbenati RM, Alach NN, Anbar HS, El-Gamal R, Tarazi H, Shehata MK, Abdel-Maksoud MS, Oh CH, El-Gamal MI..  (2021)  Discovery of first-in-class imidazothiazole-based potent and selective ErbB4 (HER4) kinase inhibitors.,  224  [PMID:34237622] [10.1016/j.ejmech.2021.113674]

Source