The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(5-(3-(Methylsulfonyl)phenyl)imidazo[2,1-b]thiazol-6-yl)phenoxy)-1-phenylethanone ID: ALA4861028
PubChem CID: 164616567
Max Phase: Preclinical
Molecular Formula: C26H20N2O4S2
Molecular Weight: 488.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)c1cccc(-c2c(-c3cccc(OCC(=O)c4ccccc4)c3)nc3sccn23)c1
Standard InChI: InChI=1S/C26H20N2O4S2/c1-34(30,31)22-12-6-10-20(16-22)25-24(27-26-28(25)13-14-33-26)19-9-5-11-21(15-19)32-17-23(29)18-7-3-2-4-8-18/h2-16H,17H2,1H3
Standard InChI Key: WJWCZLZKTCWTCS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
9.9060 -28.2337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1930 -28.6506 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.9105 -29.0596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7316 -24.4372 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.9810 -24.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0658 -25.5936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8723 -25.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2851 -25.0499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1702 -24.6026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7575 -25.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3109 -25.9314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1384 -26.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7552 -27.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5828 -28.0978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7976 -28.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1850 -27.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3533 -26.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9388 -25.4037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6010 -26.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7824 -26.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2974 -25.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6311 -24.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4538 -24.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4443 -26.9988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6213 -26.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2063 -27.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0224 -29.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3808 -27.7113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6177 -28.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2001 -29.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6108 -29.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4371 -29.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8511 -29.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4381 -28.4242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
4 8 1 0
9 10 1 0
10 11 2 0
5 9 2 0
6 11 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
14 2 1 0
11 12 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
25 26 1 0
24 25 1 0
20 24 1 0
10 18 1 0
2 27 1 0
26 28 2 0
26 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.59Molecular Weight (Monoisotopic): 488.0864AlogP: 5.40#Rotatable Bonds: 7Polar Surface Area: 77.74Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.26CX LogP: 4.31CX LogD: 4.31Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -1.75
References 1. Zaraei SO, Sbenati RM, Alach NN, Anbar HS, El-Gamal R, Tarazi H, Shehata MK, Abdel-Maksoud MS, Oh CH, El-Gamal MI.. (2021) Discovery of first-in-class imidazothiazole-based potent and selective ErbB4 (HER4) kinase inhibitors., 224 [PMID:34237622 ] [10.1016/j.ejmech.2021.113674 ]