3-((biphenyl-4-yloxy)methyl)benzoic acid

ID: ALA4861046

PubChem CID: 18707489

Max Phase: Preclinical

Molecular Formula: C20H16O3

Molecular Weight: 304.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cccc(COc2ccc(-c3ccccc3)cc2)c1

Standard InChI:  InChI=1S/C20H16O3/c21-20(22)18-8-4-5-15(13-18)14-23-19-11-9-17(10-12-19)16-6-2-1-3-7-16/h1-13H,14H2,(H,21,22)

Standard InChI Key:  UAFSXXNQRUGQOR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    3.4572   -3.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4561   -4.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1641   -4.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8738   -4.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8709   -3.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1623   -3.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7494   -3.0460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7492   -2.2288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0418   -3.4548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5771   -3.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2863   -3.4455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9925   -3.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7002   -3.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4059   -3.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4032   -2.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6890   -1.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9862   -2.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1088   -1.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8189   -2.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5240   -1.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5203   -0.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8055   -0.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1033   -0.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
M  END

Alternative Forms

Associated Targets(Human)

MRGPRX4 Tchem Mas-related G-protein coupled receptor member X4 (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 304.35Molecular Weight (Monoisotopic): 304.1099AlogP: 4.63#Rotatable Bonds: 5
Polar Surface Area: 46.53Molecular Species: ACIDHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.02CX Basic pKa: CX LogP: 4.84CX LogD: 1.70
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.75Np Likeness Score: -0.50

References

1.  (2020)  Modulators of mas-related g-protein receptor x4 and related products and methods, 

Source