2-Methyl-9-(4-trifluoromethyl-phenyl)-9H-benzo[d]imidazo[1,2-a]imidazole-3-carboxylic acid methyl ester

ID: ALA4861141

PubChem CID: 164617069

Max Phase: Preclinical

Molecular Formula: C19H14F3N3O2

Molecular Weight: 373.33

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1c(C)nc2n(-c3ccc(C(F)(F)F)cc3)c3ccccc3n12

Standard InChI:  InChI=1S/C19H14F3N3O2/c1-11-16(17(26)27-2)25-15-6-4-3-5-14(15)24(18(25)23-11)13-9-7-12(8-10-13)19(20,21)22/h3-10H,1-2H3

Standard InChI Key:  XAOKSKCKOSBSEY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   10.2644  -10.3552    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.4761  -10.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6880  -10.9327    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.0082   -6.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0792   -5.8621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3479   -6.9783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9145   -6.9023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8489   -5.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1883   -6.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3664   -6.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1199   -6.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0874   -4.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8637   -4.5619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8326   -6.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6356   -5.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9120   -4.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0637   -4.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2845   -5.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1296   -7.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3315   -7.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1131   -8.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6924   -9.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4931   -9.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7078   -8.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4869   -4.1954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6999   -3.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6866  -10.3540    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 16 12  1  0
 17 13  2  0
 18  5  1  0
 17  8  1  0
  6 14  1  0
 18 16  2  0
 11  7  2  0
 11  6  1  0
 10  8  2  0
  7 10  1  0
 11  5  1  0
 12 15  2  0
 15  4  1  0
 10  9  1  0
 14 18  1  0
 14  4  2  0
  6 19  1  0
  5  8  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 25  1  0
 25 26  1  0
 22  2  1  0
  2 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861141

    ---

Associated Targets(Human)

TRPM2 Tchem Transient receptor potential cation channel subfamily M member 2 (348 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 373.33Molecular Weight (Monoisotopic): 373.1038AlogP: 4.39#Rotatable Bonds: 2
Polar Surface Area: 48.53Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.07CX LogP: 3.88CX LogD: 3.88
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.49Np Likeness Score: -1.32

References

1. Zhao S, Zhang H, Jin H, Cai X, Zhang R, Jin Z, Yang W, Yu P, Zhang L, Liu Z..  (2021)  Design, synthesis and biological activities of benzo[d]imidazo[1,2-a]imidazole derivatives as TRPM2-specfic inhibitors.,  225  [PMID:34416664] [10.1016/j.ejmech.2021.113750]

Source