2-((1-methylpiperidin-4-yl)(7-(3-sulfamoylphenylamino)-1,6-naphthyridin-2-yl)amino)acetic acid

ID: ALA4861166

PubChem CID: 164612617

Max Phase: Preclinical

Molecular Formula: C22H26N6O4S

Molecular Weight: 470.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCC(N(CC(=O)O)c2ccc3cnc(Nc4cccc(S(N)(=O)=O)c4)cc3n2)CC1

Standard InChI:  InChI=1S/C22H26N6O4S/c1-27-9-7-17(8-10-27)28(14-22(29)30)21-6-5-15-13-24-20(12-19(15)26-21)25-16-3-2-4-18(11-16)33(23,31)32/h2-6,11-13,17H,7-10,14H2,1H3,(H,24,25)(H,29,30)(H2,23,31,32)

Standard InChI Key:  HGKZOELAYABZRE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   16.5956   -5.1095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5997   -4.2923    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.8899   -4.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2579   -5.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9675   -5.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9647   -4.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2561   -4.2961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6709   -4.2901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3801   -4.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5498   -5.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5521   -4.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8462   -4.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1375   -4.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1392   -5.5262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8457   -5.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4297   -4.2968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7221   -4.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0156   -4.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3085   -4.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3082   -5.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0209   -5.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7252   -5.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6011   -3.4756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6678   -3.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3791   -3.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3779   -2.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6705   -1.8405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9625   -2.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9620   -3.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6705   -1.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0863   -4.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7955   -4.6907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0832   -3.4676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
 10  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7 11  1  0
  6  8  1  0
  8  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 10  2  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 19  2  1  0
  2 23  1  0
  8 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
  9 31  1  0
 31 32  1  0
 31 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4861166

    ---

Associated Targets(Human)

CDK5 Tchem Cyclin-dependent kinase 5/CDK5 activator 1 (3697 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.56Molecular Weight (Monoisotopic): 470.1736AlogP: 2.01#Rotatable Bonds: 7
Polar Surface Area: 141.75Molecular Species: ZWITTERIONHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 3.88CX Basic pKa: 8.53CX LogP: -0.97CX LogD: -0.99
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.51

References

1. Sabnis RW..  (2021)  Novel Substituted 1,6-Naphthyridines as CDK 5 Inhibitors for Treating Kidney Diseases.,  12  (9.0): [PMID:34531944] [10.1021/acsmedchemlett.1c00424]

Source