The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(2-((Cyclohexylmethyl)amino)-7-(trans-4-hydroxycyclohexyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl)piperidin-1-yl)(2,6-dimethylpyridin-4-yl)methanone ID: ALA4861169
PubChem CID: 146402924
Max Phase: Preclinical
Molecular Formula: C32H44N6O2
Molecular Weight: 544.74
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C(=O)N2CCC(c3cn([C@H]4CC[C@H](O)CC4)c4nc(NCC5CCCCC5)ncc34)CC2)cc(C)n1
Standard InChI: InChI=1S/C32H44N6O2/c1-21-16-25(17-22(2)35-21)31(40)37-14-12-24(13-15-37)29-20-38(26-8-10-27(39)11-9-26)30-28(29)19-34-32(36-30)33-18-23-6-4-3-5-7-23/h16-17,19-20,23-24,26-27,39H,3-15,18H2,1-2H3,(H,33,34,36)/t26-,27-
Standard InChI Key: MLEGYBAUGFHNOW-MCZWQBSQSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
14.1195 -7.1625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1183 -7.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8332 -8.4028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8313 -6.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5467 -7.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5470 -7.9853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3331 -8.2405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8187 -7.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3327 -6.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5883 -9.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0368 -9.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2889 -10.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0954 -10.5911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6494 -9.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3969 -9.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3476 -11.3766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4035 -8.4018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6894 -7.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9746 -8.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5906 -6.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3989 -5.9522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6544 -5.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1051 -4.5555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2967 -4.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0378 -5.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3627 -3.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1703 -3.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8127 -3.1568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7173 -4.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5242 -4.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7825 -3.2653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2278 -2.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4230 -2.8203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0738 -4.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4827 -1.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2632 -7.9823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5505 -8.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5457 -9.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2596 -9.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9785 -9.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 7 1 1
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 6
2 17 1 0
17 18 1 0
18 19 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
9 20 1 0
23 26 1 0
26 27 1 0
26 28 2 0
27 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 27 1 0
30 34 1 0
32 35 1 0
19 36 1 0
19 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.74Molecular Weight (Monoisotopic): 544.3526AlogP: 5.93#Rotatable Bonds: 6Polar Surface Area: 96.17Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.99CX LogP: 4.03CX LogD: 4.02Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.40Np Likeness Score: -0.76
References 1. Zheng H, Zhao J, Li B, Zhang W, Stashko MA, Minson KA, Huey MG, Zhou Y, Earp HS, Kireev D, Graham DK, DeRyckere D, Frye SV, Wang X.. (2021) UNC5293, a potent, orally available and highly MERTK-selective inhibitor., 220 [PMID:34038857 ] [10.1016/j.ejmech.2021.113534 ]