The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-dimethoxyphenyl)-3,7-dihydroxy-8-((pyridin-4-ylmethylamino)methyl)-4H-chromen-4-one ID: ALA4861295
PubChem CID: 164613137
Max Phase: Preclinical
Molecular Formula: C24H22N2O6
Molecular Weight: 434.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2oc3c(CNCc4ccncc4)c(O)ccc3c(=O)c2O)c(OC)c1
Standard InChI: InChI=1S/C24H22N2O6/c1-30-15-3-4-16(20(11-15)31-2)24-22(29)21(28)17-5-6-19(27)18(23(17)32-24)13-26-12-14-7-9-25-10-8-14/h3-11,26-27,29H,12-13H2,1-2H3
Standard InChI Key: YMNBPPKUUPLODN-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.7063 -14.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7052 -14.9800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4132 -15.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4114 -13.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9985 -13.7521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4090 -12.9344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7001 -12.5280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1201 -14.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1189 -14.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8251 -15.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5370 -14.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5381 -14.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8274 -13.7453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8228 -16.2038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2435 -15.3901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2450 -13.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9520 -14.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6602 -13.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6626 -12.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9509 -12.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2456 -12.9411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5378 -12.5327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5375 -11.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3708 -12.5349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0780 -12.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7002 -11.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9926 -11.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9944 -10.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2876 -10.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5788 -10.4825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5813 -11.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2887 -11.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 9 2 0
8 4 2 0
4 1 1 0
1 5 1 0
4 6 1 0
6 7 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
10 14 2 0
11 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
12 16 1 0
21 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
7 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.45Molecular Weight (Monoisotopic): 434.1478AlogP: 3.57#Rotatable Bonds: 7Polar Surface Area: 114.05Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.16CX Basic pKa: 8.14CX LogP: 1.07CX LogD: 1.04Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: 0.17
References 1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P.. (2021) Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment., 64 (20.0): [PMID:34644502 ] [10.1021/acs.jmedchem.1c00087 ]