2-(2,4-dimethoxyphenyl)-3,7-dihydroxy-8-((pyridin-4-ylmethylamino)methyl)-4H-chromen-4-one

ID: ALA4861295

PubChem CID: 164613137

Max Phase: Preclinical

Molecular Formula: C24H22N2O6

Molecular Weight: 434.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2oc3c(CNCc4ccncc4)c(O)ccc3c(=O)c2O)c(OC)c1

Standard InChI:  InChI=1S/C24H22N2O6/c1-30-15-3-4-16(20(11-15)31-2)24-22(29)21(28)17-5-6-19(27)18(23(17)32-24)13-26-12-14-7-9-25-10-8-14/h3-11,26-27,29H,12-13H2,1-2H3

Standard InChI Key:  YMNBPPKUUPLODN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   12.7063  -14.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7052  -14.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4132  -15.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4114  -13.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9985  -13.7521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4090  -12.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7001  -12.5280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1201  -14.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1189  -14.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8251  -15.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5370  -14.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5381  -14.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8274  -13.7453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8228  -16.2038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2435  -15.3901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2450  -13.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9520  -14.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6602  -13.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6626  -12.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9509  -12.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2456  -12.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5378  -12.5327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5375  -11.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3708  -12.5349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0780  -12.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7002  -11.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9926  -11.2985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9944  -10.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2876  -10.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5788  -10.4825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5813  -11.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2887  -11.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  9  2  0
  8  4  2  0
  4  1  1  0
  1  5  1  0
  4  6  1  0
  6  7  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 10 14  2  0
 11 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 12 16  1  0
 21 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  1  0
  7 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861295

    ---

Associated Targets(Human)

RPMI-8226 (44974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.45Molecular Weight (Monoisotopic): 434.1478AlogP: 3.57#Rotatable Bonds: 7
Polar Surface Area: 114.05Molecular Species: ACIDHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.16CX Basic pKa: 8.14CX LogP: 1.07CX LogD: 1.04
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: 0.17

References

1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P..  (2021)  Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment.,  64  (20.0): [PMID:34644502] [10.1021/acs.jmedchem.1c00087]

Source