(S)-4-(2-(2-(3-chloro-2-fluorophenyl)-4-methyl-1H-imidazole-5-carboxamido)-3-phenylpropanamido)benzoic acid

ID: ALA4861304

PubChem CID: 164613144

Max Phase: Preclinical

Molecular Formula: C27H22ClFN4O4

Molecular Weight: 520.95

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2cccc(Cl)c2F)[nH]c1C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C27H22ClFN4O4/c1-15-23(33-24(30-15)19-8-5-9-20(28)22(19)29)26(35)32-21(14-16-6-3-2-4-7-16)25(34)31-18-12-10-17(11-13-18)27(36)37/h2-13,21H,14H2,1H3,(H,30,33)(H,31,34)(H,32,35)(H,36,37)/t21-/m0/s1

Standard InChI Key:  IDAQUZHJQGZWLK-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   22.6667  -25.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3744  -25.5187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0822  -25.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0796  -26.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7865  -27.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4952  -26.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4926  -25.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7851  -25.5191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2034  -27.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2045  -27.9702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9106  -26.7435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9590  -25.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2513  -25.9273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5436  -25.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6667  -26.7444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9590  -24.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6667  -24.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3740  -24.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0812  -24.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0817  -23.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3690  -23.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6647  -23.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5436  -24.7015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8359  -25.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0880  -25.5992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5412  -26.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9498  -26.9143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7491  -26.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3561  -27.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7333  -26.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4017  -25.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5897  -25.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1085  -25.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4450  -26.7005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2560  -26.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9670  -27.3633    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.5904  -27.5282    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
  9 11  1  0
  1 12  1  0
 12 13  1  0
 13 14  1  0
  1 15  2  0
 12 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 14 23  2  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  2  0
 28 29  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 26 30  1  0
 34 36  1  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861304

    ---

Associated Targets(Human)

F11 Tchem Coagulation factor XI (1733 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.95Molecular Weight (Monoisotopic): 520.1314AlogP: 4.86#Rotatable Bonds: 8
Polar Surface Area: 124.18Molecular Species: ACIDHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.40CX Basic pKa: 3.79CX LogP: 4.02CX LogD: 1.49
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -1.03

References

1. Lei Y, Zhang B, Zhang Y, Dai X, Duan Y, Mao Q, Gao J, Yang Y, Bao Z, Fu X, Ping K, Yan C, Mou Y, Wang S..  (2021)  Design, synthesis and biological evaluation of novel FXIa inhibitors with 2-phenyl-1H-imidazole-5-carboxamide moiety as P1 fragment.,  220  [PMID:33894565] [10.1016/j.ejmech.2021.113437]

Source