N-((1S,4S)-4-(2-((2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)amino)-5-methyl-7-oxopyrido[2,3-d]pyrimidin-8(7H)-yl)cyclohexyl)acetamide

ID: ALA4861308

PubChem CID: 164615294

Max Phase: Preclinical

Molecular Formula: C28H37N7O3

Molecular Weight: 519.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2c(C)cc(=O)n([C@H]3CC[C@@H](NC(C)=O)CC3)c2n1

Standard InChI:  InChI=1S/C28H37N7O3/c1-18-15-26(37)35(21-7-5-20(6-8-21)30-19(2)36)27-23(18)17-29-28(32-27)31-24-10-9-22(16-25(24)38-4)34-13-11-33(3)12-14-34/h9-10,15-17,20-21H,5-8,11-14H2,1-4H3,(H,30,36)(H,29,31,32)/t20-,21+

Standard InChI Key:  QUZWZIAVIKGASM-OYRHEFFESA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   16.5038  -12.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5064  -13.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2096  -12.5457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7956  -12.5532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7889  -11.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0806  -11.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0740  -10.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7797  -10.1016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4921  -10.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4946  -11.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6507   -8.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3590   -9.2919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0648   -8.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0622   -8.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3539   -7.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6482   -8.0719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7680   -7.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4762   -8.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4829   -8.8701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7772   -9.2845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1912   -9.2770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7654   -6.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9450   -9.2993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2367   -8.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5310   -9.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8186   -8.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8160   -8.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5218   -7.6724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2301   -8.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1036   -7.6798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3979   -8.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6896   -7.6872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6871   -6.8700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3928   -6.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1011   -6.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9747   -6.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5335  -10.1239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8278  -10.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  5 10  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 13 20  1  0
 14 17  1  0
 19 21  2  0
 17 22  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 30 35  1  0
 33 36  1  0
 27 30  1  0
 37 38  1  0
 25 37  1  0
 23 24  1  0
 11 23  1  0
  8 20  1  1
  5  4  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4861308

    ---

Associated Targets(Human)

TTK Tchem Dual specificity protein kinase TTK (2978 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.65Molecular Weight (Monoisotopic): 519.2958AlogP: 3.22#Rotatable Bonds: 6
Polar Surface Area: 104.62Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.99CX Basic pKa: 7.84CX LogP: 2.47CX LogD: 1.89
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.51Np Likeness Score: -1.24

References

1. Huang M, Huang Y, Guo J, Yu L, Chang Y, Wang X, Luo J, Huang Y, Tu Z, Lu X, Xu Y, Zhang Z, Zhang Z, Ding K..  (2021)  Pyrido[2, 3-d]pyrimidin-7(8H)-ones as new selective orally bioavailable Threonine Tyrosine Kinase (TTK) inhibitors.,  211  [PMID:33248853] [10.1016/j.ejmech.2020.113023]

Source