The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((1S,4S)-4-(2-((2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)amino)-5-methyl-7-oxopyrido[2,3-d]pyrimidin-8(7H)-yl)cyclohexyl)acetamide ID: ALA4861308
PubChem CID: 164615294
Max Phase: Preclinical
Molecular Formula: C28H37N7O3
Molecular Weight: 519.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2c(C)cc(=O)n([C@H]3CC[C@@H](NC(C)=O)CC3)c2n1
Standard InChI: InChI=1S/C28H37N7O3/c1-18-15-26(37)35(21-7-5-20(6-8-21)30-19(2)36)27-23(18)17-29-28(32-27)31-24-10-9-22(16-25(24)38-4)34-13-11-33(3)12-14-34/h9-10,15-17,20-21H,5-8,11-14H2,1-4H3,(H,30,36)(H,29,31,32)/t20-,21+
Standard InChI Key: QUZWZIAVIKGASM-OYRHEFFESA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
16.5038 -12.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5064 -13.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2096 -12.5457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7956 -12.5532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7889 -11.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0806 -11.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0740 -10.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7797 -10.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4921 -10.5044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4946 -11.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6507 -8.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3590 -9.2919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0648 -8.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0622 -8.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3539 -7.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6482 -8.0719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7680 -7.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4762 -8.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4829 -8.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7772 -9.2845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1912 -9.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7654 -6.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9450 -9.2993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2367 -8.8965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5310 -9.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8186 -8.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8160 -8.0867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5218 -7.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2301 -8.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1036 -7.6798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3979 -8.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6896 -7.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6871 -6.8700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3928 -6.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1011 -6.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9747 -6.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5335 -10.1239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8278 -10.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
5 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
17 18 2 0
18 19 1 0
19 20 1 0
13 20 1 0
14 17 1 0
19 21 2 0
17 22 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
30 35 1 0
33 36 1 0
27 30 1 0
37 38 1 0
25 37 1 0
23 24 1 0
11 23 1 0
8 20 1 1
5 4 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.65Molecular Weight (Monoisotopic): 519.2958AlogP: 3.22#Rotatable Bonds: 6Polar Surface Area: 104.62Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.99CX Basic pKa: 7.84CX LogP: 2.47CX LogD: 1.89Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.51Np Likeness Score: -1.24
References 1. Huang M, Huang Y, Guo J, Yu L, Chang Y, Wang X, Luo J, Huang Y, Tu Z, Lu X, Xu Y, Zhang Z, Zhang Z, Ding K.. (2021) Pyrido[2, 3-d]pyrimidin-7(8H)-ones as new selective orally bioavailable Threonine Tyrosine Kinase (TTK) inhibitors., 211 [PMID:33248853 ] [10.1016/j.ejmech.2020.113023 ]