The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-chloro-N-((R)-1-((1R,3S,5S,6r)-3-(5,6-difluoro-1H-benzo[d]imidazol-1-yl)bicyclo[3.1.0]hexan-6-yl)propyl)benzamide ID: ALA4861332
PubChem CID: 148916634
Max Phase: Preclinical
Molecular Formula: C23H22ClF2N3O
Molecular Weight: 429.90
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H](NC(=O)c1ccc(Cl)cc1)[C@H]1[C@@H]2C[C@@H](n3cnc4cc(F)c(F)cc43)C[C@@H]21
Standard InChI: InChI=1S/C23H22ClF2N3O/c1-2-19(28-23(30)12-3-5-13(24)6-4-12)22-15-7-14(8-16(15)22)29-11-27-20-9-17(25)18(26)10-21(20)29/h3-6,9-11,14-16,19,22H,2,7-8H2,1H3,(H,28,30)/t14-,15-,16+,19-,22+/m1/s1
Standard InChI Key: PJRNKUWABSYXJP-PZJWQNMWSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
29.3868 -6.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4259 -7.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8572 -6.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6835 -6.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1147 -5.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7207 -5.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8910 -5.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6034 -7.1581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2108 -6.4351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8185 -7.9025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6546 -6.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6854 -5.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9104 -5.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4005 -6.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8605 -7.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5970 -5.6095 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.4378 -7.5914 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.6787 -5.1524 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.5763 -6.3324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3001 -6.7349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0816 -6.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3082 -5.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0936 -5.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2738 -4.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6696 -4.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8824 -4.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7058 -5.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6418 -5.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4642 -5.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2505 -5.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8489 -3.5060 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.1495 -4.3680 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.2754 -4.0021 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
12 1 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 29 2 0
29 3 1 0
2 8 1 0
9 8 1 0
2 10 2 0
9 1 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
11 15 1 0
1 16 1 1
11 17 1 6
12 18 1 6
14 19 1 6
19 23 1 0
22 20 1 0
20 21 2 0
21 19 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
9 28 1 1
28 30 1 0
25 31 1 0
6 32 1 0
26 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.90Molecular Weight (Monoisotopic): 429.1419AlogP: 5.37#Rotatable Bonds: 5Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.55CX LogP: 4.83CX LogD: 4.82Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -0.85
References 1. Hamilton MM, Mseeh F, McAfoos TJ, Leonard PG, Reyna NJ, Harris AL, Xu A, Han M, Soth MJ, Czako B, Theroff JP, Mandal PK, Burke JP, Virgin-Downey B, Petrocchi A, Pfaffinger D, Rogers NE, Parker CA, Yu SS, Jiang Y, Krapp S, Lammens A, Trevitt G, Tremblay MR, Mikule K, Wilcoxen K, Cross JB, Jones P, Marszalek JR, Lewis RT.. (2021) Discovery of IACS-9779 and IACS-70465 as Potent Inhibitors Targeting Indoleamine 2,3-Dioxygenase 1 (IDO1) Apoenzyme., 64 (15.0): [PMID:34292726 ] [10.1021/acs.jmedchem.1c00679 ]