The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(Dimethylamino)phenyl)(4-(7-(trans-4-hydroxycyclohexyl)-2-(((S)-pentan-2-yl)amino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl)piperidin-1-yl)methanone ID: ALA4861342
PubChem CID: 146402990
Max Phase: Preclinical
Molecular Formula: C31H44N6O2
Molecular Weight: 532.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@H](C)Nc1ncc2c(C3CCN(C(=O)c4ccc(N(C)C)cc4)CC3)cn([C@H]3CC[C@H](O)CC3)c2n1
Standard InChI: InChI=1S/C31H44N6O2/c1-5-6-21(2)33-31-32-19-27-28(20-37(29(27)34-31)25-11-13-26(38)14-12-25)22-15-17-36(18-16-22)30(39)23-7-9-24(10-8-23)35(3)4/h7-10,19-22,25-26,38H,5-6,11-18H2,1-4H3,(H,32,33,34)/t21-,25-,26-/m0/s1
Standard InChI Key: WTBRDNQZOOILBP-MZBJOSPHSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
38.0933 -5.4706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0922 -6.2979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8069 -6.7108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8051 -5.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5206 -5.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5208 -6.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3069 -6.5486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7925 -5.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3065 -5.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5620 -7.3331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0106 -7.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2628 -8.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0692 -8.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6231 -8.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3706 -7.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3213 -9.6846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3774 -6.7099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6633 -6.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9484 -6.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2344 -6.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5196 -6.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6639 -5.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5644 -4.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3726 -4.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6280 -3.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0788 -2.8637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2705 -3.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0116 -3.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3364 -2.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1439 -1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7865 -1.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6911 -2.5262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4979 -2.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7562 -1.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2015 -0.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3967 -1.1285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5635 -1.4037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.1142 -2.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8201 -0.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 7 1 1
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 6
2 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
18 22 1 6
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
9 23 1 0
26 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 30 1 0
34 37 1 0
37 38 1 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.73Molecular Weight (Monoisotopic): 532.3526AlogP: 5.59#Rotatable Bonds: 8Polar Surface Area: 86.52Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.93CX LogP: 4.72CX LogD: 4.71Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.39Np Likeness Score: -0.91
References 1. Zheng H, Zhao J, Li B, Zhang W, Stashko MA, Minson KA, Huey MG, Zhou Y, Earp HS, Kireev D, Graham DK, DeRyckere D, Frye SV, Wang X.. (2021) UNC5293, a potent, orally available and highly MERTK-selective inhibitor., 220 [PMID:34038857 ] [10.1016/j.ejmech.2021.113534 ]