3-(5-(2-(Methylsulfonyl)pyrimidin-4-yl)imidazo[2,1-b]thiazol-6-yl)phenyl sulfamate

ID: ALA4861429

PubChem CID: 164615338

Max Phase: Preclinical

Molecular Formula: C16H13N5O5S3

Molecular Weight: 451.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)c1nccc(-c2c(-c3cccc(OS(N)(=O)=O)c3)nc3sccn23)n1

Standard InChI:  InChI=1S/C16H13N5O5S3/c1-28(22,23)15-18-6-5-12(19-15)14-13(20-16-21(14)7-8-27-16)10-3-2-4-11(9-10)26-29(17,24)25/h2-9H,1H3,(H2,17,24,25)

Standard InChI Key:  JOSDUFCGFDRLOF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    8.4124  -10.8665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1999  -10.0707    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.6169  -10.6527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8928   -6.8263    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.1081   -7.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1081   -7.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8928   -8.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3775   -7.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3235   -6.8263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8388   -7.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3235   -8.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0075   -9.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2604   -9.1184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0706   -8.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6195   -9.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3665  -10.3429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5605  -10.5153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0138   -7.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6013   -8.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7763   -8.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3638   -7.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7763   -6.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6013   -6.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6516   -9.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3644   -6.0653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7776   -5.3512    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3657   -4.6363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4920   -4.9387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3609   -5.9345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  4  8  1  0
  9 10  1  0
 10 11  2  0
  5  9  2  0
  6 11  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 12  2  1  0
 11 14  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 10 18  1  0
  2 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 26 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4861429

    ---

Associated Targets(Human)

Panel NCI-60 (60 carcinoma cell lines) (1088 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.51Molecular Weight (Monoisotopic): 451.0079AlogP: 1.51#Rotatable Bonds: 5
Polar Surface Area: 146.61Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.79CX Basic pKa: 2.58CX LogP: 1.02CX LogD: 1.02
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.45Np Likeness Score: -1.65

References

1. Zaraei SO, Sbenati RM, Alach NN, Anbar HS, El-Gamal R, Tarazi H, Shehata MK, Abdel-Maksoud MS, Oh CH, El-Gamal MI..  (2021)  Discovery of first-in-class imidazothiazole-based potent and selective ErbB4 (HER4) kinase inhibitors.,  224  [PMID:34237622] [10.1016/j.ejmech.2021.113674]

Source