(2S,3R)-2-(3-((2-chloro-4-(trifluoromethyl)phenoxy)methyl)benzamido)-3-hydroxybutanoic acid

ID: ALA4861439

PubChem CID: 155154049

Max Phase: Preclinical

Molecular Formula: C19H17ClF3NO5

Molecular Weight: 431.79

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](O)[C@H](NC(=O)c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1)C(=O)O

Standard InChI:  InChI=1S/C19H17ClF3NO5/c1-10(25)16(18(27)28)24-17(26)12-4-2-3-11(7-12)9-29-15-6-5-13(8-14(15)20)19(21,22)23/h2-8,10,16,25H,9H2,1H3,(H,24,26)(H,27,28)/t10-,16+/m1/s1

Standard InChI Key:  BJZLUOFFHKRKBP-HWPZZCPQSA-N

Molfile:  

 
     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
    4.4519  -22.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4507  -23.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1588  -23.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8684  -23.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8656  -22.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1570  -21.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5718  -21.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2810  -22.2368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9872  -21.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6948  -22.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4005  -21.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3979  -21.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6837  -20.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9809  -21.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2701  -20.6102    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.1035  -20.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8133  -20.9990    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.0993  -19.7768    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.8092  -20.1780    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.7441  -21.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7439  -21.0201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0364  -22.2461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3286  -21.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6210  -22.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6212  -23.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9132  -21.8380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3284  -21.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0361  -20.6117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6206  -20.6120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 12 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
  1 20  1  0
 20 21  2  0
 20 22  1  0
 23 22  1  1
 23 24  1  0
 24 25  1  0
 24 26  1  1
 23 27  1  0
 27 28  2  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861439

    ---

Associated Targets(Human)

MRGPRX4 Tchem Mas-related G-protein coupled receptor member X4 (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.79Molecular Weight (Monoisotopic): 431.0747AlogP: 3.50#Rotatable Bonds: 7
Polar Surface Area: 95.86Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.31CX Basic pKa: CX LogP: 3.51CX LogD: 0.09
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.62Np Likeness Score: -1.06

References

1.  (2020)  Modulators of mas-related g-protein receptor x4 and related products and methods, 

Source