4-bromo-6-((2-chloro-4-(trifluoromethyl)phenoxy)methyl)picolinic acid

ID: ALA4861516

PubChem CID: 155146077

Max Phase: Preclinical

Molecular Formula: C14H8BrClF3NO3

Molecular Weight: 410.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(Br)cc(COc2ccc(C(F)(F)F)cc2Cl)n1

Standard InChI:  InChI=1S/C14H8BrClF3NO3/c15-8-4-9(20-11(5-8)13(21)22)6-23-12-2-1-7(3-10(12)16)14(17,18)19/h1-5H,6H2,(H,21,22)

Standard InChI Key:  VZZWALQOKPULPK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    3.6182  -28.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6170  -29.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3251  -29.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0347  -29.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0319  -28.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3233  -28.1887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9104  -28.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9102  -27.3719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2027  -28.5979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7381  -28.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4473  -28.5886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1535  -28.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8611  -28.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5668  -28.1761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5642  -27.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8500  -26.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1472  -27.3652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3249  -30.6432    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    6.4364  -26.9620    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.2698  -26.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9796  -27.3508    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.2656  -26.1286    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.9755  -26.5298    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  3 18  1  0
 17 19  1  0
 15 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861516

    ---

Associated Targets(Human)

MRGPRX4 Tchem Mas-related G-protein coupled receptor member X4 (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.57Molecular Weight (Monoisotopic): 408.9328AlogP: 4.79#Rotatable Bonds: 4
Polar Surface Area: 59.42Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 0.88CX Basic pKa: 5.04CX LogP: 3.32CX LogD: 1.38
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.79Np Likeness Score: -1.34

References

1.  (2020)  Modulators of mas-related g-protein receptor x4 and related products and methods, 

Source