The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-N4-(2-(ethylsulfinyl)-4-fluorophenyl)-N2-(2-methoxy-4-(4-methyl-1,4-diazepan-1-yl)phenyl)pyrimidine-2,4-diamine ID: ALA4861523
PubChem CID: 164615858
Max Phase: Preclinical
Molecular Formula: C25H30ClFN6O2S
Molecular Weight: 533.07
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[S+]([O-])c1cc(F)ccc1Nc1nc(Nc2ccc(N3CCCN(C)CC3)cc2OC)ncc1Cl
Standard InChI: InChI=1S/C25H30ClFN6O2S/c1-4-36(34)23-14-17(27)6-8-21(23)29-24-19(26)16-28-25(31-24)30-20-9-7-18(15-22(20)35-3)33-11-5-10-32(2)12-13-33/h6-9,14-16H,4-5,10-13H2,1-3H3,(H2,28,29,30,31)
Standard InChI Key: WHXOECBMCCQXEG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
34.4440 -4.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4428 -5.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1577 -5.7985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8741 -5.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8712 -4.5547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1559 -4.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7295 -4.1459 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
35.1535 -3.3205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4377 -2.9101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4386 -2.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7237 -1.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0096 -2.0903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0147 -2.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7301 -3.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1527 -1.6729 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.8675 -2.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1521 -0.8479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5892 -5.7965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7294 -7.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5905 -6.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8754 -7.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8763 -7.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5920 -8.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3081 -7.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3037 -7.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0161 -6.6130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5818 -1.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5944 -9.0950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8277 -9.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6690 -10.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3374 -9.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5039 -10.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9544 -10.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1638 -10.9050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7906 -11.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2933 -1.6809 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
10 15 1 0
15 16 1 0
15 17 1 0
4 18 1 0
26 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
25 26 1 0
16 27 1 0
23 28 1 0
28 29 1 0
29 30 1 0
28 31 1 0
32 33 1 0
33 34 1 0
34 30 1 0
31 32 1 0
34 35 1 0
12 36 1 0
M CHG 2 15 1 17 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.07Molecular Weight (Monoisotopic): 532.1824AlogP: 5.03#Rotatable Bonds: 8Polar Surface Area: 88.61Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.21CX Basic pKa: 8.85CX LogP: 4.05CX LogD: 2.59Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -1.49
References 1. Wu F, Yao H, Li W, Zhang N, Fan Y, Chan ASC, Li X, An B.. (2021) Synthesis and evaluation of novel 2,4-diaminopyrimidines bearing a sulfoxide moiety as anaplastic lymphoma kinase (ALK) inhibition agents., 48 [PMID:34245852 ] [10.1016/j.bmcl.2021.128253 ]