The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 2-(4-((1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl)-2-(trifluoromethyl)phenoxy)acetate ID: ALA4861528
PubChem CID: 164615861
Max Phase: Preclinical
Molecular Formula: C27H27F3O7
Molecular Weight: 520.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCC(=O)OC(C)(C)C)c(C(F)(F)F)c2)ccc1O
Standard InChI: InChI=1S/C27H27F3O7/c1-26(2,3)37-25(34)16-36-23-12-8-17(13-21(23)27(28,29)30)5-9-19(31)15-20(32)10-6-18-7-11-22(33)24(14-18)35-4/h5-14,33H,15-16H2,1-4H3/b9-5+,10-6+
Standard InChI Key: LFQWAUFBBMJFBL-NXZHAISVSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
5.6500 -27.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3645 -26.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0789 -27.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7934 -26.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5080 -27.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3645 -25.9960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7934 -25.9960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9355 -26.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2211 -27.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2224 -26.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9369 -27.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9348 -28.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6485 -28.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3638 -28.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3612 -27.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6470 -26.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5072 -26.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7932 -27.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7928 -28.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5123 -28.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2233 -28.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0788 -28.4690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0789 -26.8168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0793 -25.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0743 -26.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7901 -27.2252 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.0713 -25.9902 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7834 -26.3960 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.0789 -28.4710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7929 -28.0575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5078 -28.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2218 -28.0556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5089 -29.2942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9368 -28.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9379 -29.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6507 -28.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6459 -28.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
2 6 2 0
4 7 2 0
1 8 2 0
8 9 1 0
5 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 9 1 0
19 22 1 0
18 23 1 0
23 24 1 0
15 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
14 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.50Molecular Weight (Monoisotopic): 520.1709AlogP: 5.40#Rotatable Bonds: 10Polar Surface Area: 99.13Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.28CX Basic pKa: ┄CX LogP: 5.98CX LogD: 5.98Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: 0.00
References 1. Yudi Utomo R, Asawa Y, Okada S, Ban HS, Yoshimori A, Bajorath J, Nakamura H.. (2021) Development of curcumin-based amyloid β aggregation inhibitors for Alzheimer's disease using the SAR matrix approach., 46 [PMID:34391121 ] [10.1016/j.bmc.2021.116357 ]