The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-(6-ethylpyridin-3-yl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione ID: ALA4861624
PubChem CID: 155088300
Max Phase: Preclinical
Molecular Formula: C23H20N2O2
Molecular Weight: 356.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(C2C3=C(CCCC3=O)NC3=C2C(=O)c2ccccc23)cn1
Standard InChI: InChI=1S/C23H20N2O2/c1-2-14-11-10-13(12-24-14)19-20-17(8-5-9-18(20)26)25-22-15-6-3-4-7-16(15)23(27)21(19)22/h3-4,6-7,10-12,19,25H,2,5,8-9H2,1H3
Standard InChI Key: GYJJHWLXCSGMED-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 31 0 0 0 0 0 0 0 0999 V2000
40.6744 -12.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6744 -11.3176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.3870 -11.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3835 -12.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0929 -12.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8102 -12.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8138 -11.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0998 -11.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9618 -12.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9619 -11.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1766 -12.8153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6912 -12.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1771 -11.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8429 -10.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0229 -10.6425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5385 -11.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8754 -12.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6744 -13.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9581 -14.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9586 -15.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6747 -15.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3916 -15.0258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.3876 -14.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0882 -13.7995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9214 -13.6005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6767 -16.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9627 -16.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 2 1 0
9 1 1 0
1 4 1 0
3 2 1 0
3 4 2 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
9 10 2 0
10 13 1 0
12 11 1 0
11 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
1 18 1 0
5 24 2 0
11 25 2 0
21 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 356.43Molecular Weight (Monoisotopic): 356.1525AlogP: 3.95#Rotatable Bonds: 2Polar Surface Area: 59.06Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.35CX LogP: 2.52CX LogD: 2.52Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.89Np Likeness Score: -0.59
References 1. (2020) Inhibitors of GPR174 and Uses Thereof, 2. (2020) Methods and Compositions for Treating Cancer,