The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((2-chloro-4-(trifluoromethyl)phenoxy)methyl)-N-(3-methoxypropyl)benzamide ID: ALA4861738
PubChem CID: 155154018
Max Phase: Preclinical
Molecular Formula: C19H19ClF3NO3
Molecular Weight: 401.81
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCCNC(=O)c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1
Standard InChI: InChI=1S/C19H19ClF3NO3/c1-26-9-3-8-24-18(25)14-5-2-4-13(10-14)12-27-17-7-6-15(11-16(17)20)19(21,22)23/h2,4-7,10-11H,3,8-9,12H2,1H3,(H,24,25)
Standard InChI Key: MCSDDJPYBXCCHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
6.0202 -15.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0191 -16.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7271 -16.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4368 -16.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4339 -15.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7253 -15.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1401 -15.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8493 -15.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5555 -15.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2632 -15.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9689 -15.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9662 -14.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2520 -13.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5492 -14.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8384 -13.9902 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.6718 -13.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3816 -14.3789 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.6677 -13.1568 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.3776 -13.5579 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3124 -15.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3122 -14.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6048 -15.6260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8970 -15.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1894 -15.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4816 -15.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7740 -15.6267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0662 -15.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
12 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
1 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.81Molecular Weight (Monoisotopic): 401.1006AlogP: 4.70#Rotatable Bonds: 8Polar Surface Area: 47.56Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.11CX LogD: 4.11Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.65Np Likeness Score: -1.51
References 1. (2020) Modulators of mas-related g-protein receptor x4 and related products and methods,