15beta-hydroxywithanolide D

ID: ALA4861753

PubChem CID: 164611495

Max Phase: Preclinical

Molecular Formula: C28H38O7

Molecular Weight: 486.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C(C)C(=O)O[C@@H]([C@](C)(O)[C@H]2C[C@@H](O)[C@H]3[C@@H]4C[C@H]5O[C@]56[C@@H](O)C=CC(=O)[C@]6(C)[C@H]4CC[C@@]32C)C1

Standard InChI:  InChI=1S/C28H38O7/c1-13-10-21(34-24(32)14(13)2)27(5,33)18-12-17(29)23-15-11-22-28(35-22)20(31)7-6-19(30)26(28,4)16(15)8-9-25(18,23)3/h6-7,15-18,20-23,29,31,33H,8-12H2,1-5H3/t15-,16+,17-,18+,20+,21-,22-,23-,25-,26+,27-,28-/m1/s1

Standard InChI Key:  PNSAXLUIESEAGV-OZDUSQFJSA-N

Molfile:  

 
     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
   13.0727  -22.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8729  -23.1784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6606  -22.3773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6848  -22.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6848  -23.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3968  -23.4255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1089  -23.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1089  -22.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3968  -21.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2556  -26.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9677  -26.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9677  -25.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6798  -25.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1020  -26.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3922  -25.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1017  -25.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1186  -23.7867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3975  -24.1904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8282  -24.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8193  -25.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5980  -25.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0882  -24.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6124  -23.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3851  -26.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6776  -26.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6787  -27.0720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9677  -24.1827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6724  -24.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0934  -24.6079    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.6329  -23.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3850  -25.8372    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8144  -25.8538    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.4354  -23.9576    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.8230  -23.4307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8248  -21.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3968  -20.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3940  -22.5992    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.7934  -27.3749    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2532  -25.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9656  -27.4833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8443  -26.0787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
 39 12  1  0
 10 11  1  0
 11 25  1  0
 13 12  1  0
 13 25  1  0
 13 15  1  0
 24 14  1  0
 14 16  1  0
 15 16  1  0
 15 18  1  0
 16 20  1  0
 19 17  1  0
 17 18  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 23  2  1  0
  2  5  1  0
 25 24  1  0
 25 26  1  1
 24 26  1  0
 12 27  2  0
 13 28  1  1
 16 29  1  1
 19 30  1  1
 15 31  1  6
 20 32  1  6
 23 33  1  6
  7 34  2  0
  8 35  1  0
  9 36  1  0
  5 37  1  6
 24 38  1  6
 10 39  2  0
 11 40  1  1
 21 41  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4861753

    ---

Associated Targets(Human)

NFKB2 Tchem Nuclear factor NF-kappa-B complex (2307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.61Molecular Weight (Monoisotopic): 486.2618AlogP: 2.47#Rotatable Bonds: 2
Polar Surface Area: 116.59Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.28CX Basic pKa: CX LogP: 2.47CX LogD: 2.47
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: 3.61

References

1. Freitas Misakyan MF, Wijeratne EMK, Issa ME, Xu YM, Monteillier A, Gunatilaka AAL, Cuendet M..  (2021)  Structure-Activity Relationships of Withanolides as Antiproliferative Agents for Multiple Myeloma: Comparison of Activity in 2D Models and a 3D Coculture Model.,  84  (8.0): [PMID:34445874] [10.1021/acs.jnatprod.1c00446]

Source