(E)-3-(4-methoxy-3,5-dimethylphenyl)-1-(4-(methylthio)phenyl)prop-2-en-1-one

ID: ALA4861777

PubChem CID: 156783244

Max Phase: Preclinical

Molecular Formula: C19H20O2S

Molecular Weight: 312.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1c(C)cc(/C=C/C(=O)c2ccc(SC)cc2)cc1C

Standard InChI:  InChI=1S/C19H20O2S/c1-13-11-15(12-14(2)19(13)21-3)5-10-18(20)16-6-8-17(22-4)9-7-16/h5-12H,1-4H3/b10-5+

Standard InChI Key:  ZMZLMWUNDPFSNY-BJMVGYQFSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   15.4633   -2.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4622   -3.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1702   -3.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8799   -3.0106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8770   -2.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1684   -1.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5832   -1.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2924   -2.1826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9986   -1.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5801   -0.9595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7079   -2.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7078   -2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4162   -3.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1234   -2.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1177   -2.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4087   -1.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8332   -3.3928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8224   -1.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4189   -4.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5388   -2.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7541   -3.4191    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.0467   -3.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  7 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 15 18  1  0
 13 19  1  0
 17 20  1  0
  2 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861777

    ---

Associated Targets(non-human)

Nlrp3 NACHT, LRR and PYD domains-containing protein 3 (641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 312.43Molecular Weight (Monoisotopic): 312.1184AlogP: 4.93#Rotatable Bonds: 5
Polar Surface Area: 26.30Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.39CX LogD: 5.39
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.44Np Likeness Score: -0.41

References

1. Zhang C, Yue H, Sun P, Hua L, Liang S, Ou Y, Wu D, Wu X, Chen H, Hao Y, Hu W, Yang Z..  (2021)  Discovery of chalcone analogues as novel NLRP3 inflammasome inhibitors with potent anti-inflammation activities.,  219  [PMID:33845232] [10.1016/j.ejmech.2021.113417]

Source