The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl 2-(3-(3-(cyclopropyl(4-(thiophen-2-yl)benzyl)carbamoyl)piperidin-1-yl)phenoxy)-2-methylpropanoate ID: ALA4861802
PubChem CID: 156180146
Max Phase: Preclinical
Molecular Formula: C34H42N2O4S
Molecular Weight: 574.79
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)C(C)(C)Oc1cccc(N2CCCC(C(=O)N(Cc3ccc(-c4cccs4)cc3)C3CC3)C2)c1
Standard InChI: InChI=1S/C34H42N2O4S/c1-33(2,3)40-32(38)34(4,5)39-29-11-6-10-28(21-29)35-19-7-9-26(23-35)31(37)36(27-17-18-27)22-24-13-15-25(16-14-24)30-12-8-20-41-30/h6,8,10-16,20-21,26-27H,7,9,17-19,22-23H2,1-5H3
Standard InChI Key: ABDQLSSEUUOPSE-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
28.1252 -13.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7183 -12.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3026 -13.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4193 -11.0873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4181 -11.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1346 -12.3316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8528 -11.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8500 -11.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1328 -10.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7071 -10.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5697 -12.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2853 -11.9132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0020 -12.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7176 -11.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0033 -13.1538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4345 -12.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7163 -11.0847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4318 -10.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1459 -11.9088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1446 -11.0825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8627 -12.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8597 -13.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5758 -13.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2924 -13.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2884 -12.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5718 -11.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0025 -11.8962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4348 -11.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1490 -12.3006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4307 -11.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2791 -11.0910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6891 -10.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8669 -10.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6209 -9.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8166 -9.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4057 -10.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9561 -11.0116 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.8607 -11.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5731 -12.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8601 -11.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5668 -11.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
14 17 1 0
17 18 1 0
16 19 1 0
18 20 1 0
19 20 1 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
25 27 1 0
27 2 1 0
2 28 1 0
28 29 1 0
28 30 2 0
32 31 1 0
33 32 1 0
31 33 1 0
12 31 1 0
10 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 10 1 0
29 38 1 0
38 39 1 0
38 40 1 0
38 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.79Molecular Weight (Monoisotopic): 574.2865AlogP: 7.32#Rotatable Bonds: 9Polar Surface Area: 59.08Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.84CX LogP: 7.09CX LogD: 7.09Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.25Np Likeness Score: -1.58
References 1. Wang Z, Zhang M, Luo W, Zhang Y, Ji H.. (2021) Discovery of 2-(3-(3-Carbamoylpiperidin-1-yl)phenoxy)acetic Acid Derivatives as Novel Small-Molecule Inhibitors of the β-Catenin/B-Cell Lymphoma 9 Protein-Protein Interaction., 64 (9.0): [PMID:33902288 ] [10.1021/acs.jmedchem.1c00046 ]