2-(4,5-Dichloro-6-oxo-pyridazin-1-yl)-N-methyl-N-[4-methyl-3-[2-(2-pyridyl)ethylsulfamoyl]phenyl]aceramide

ID: ALA4861803

PubChem CID: 162727133

Max Phase: Preclinical

Molecular Formula: C21H21Cl2N5O4S

Molecular Weight: 510.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(N(C)C(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1S(=O)(=O)NCCc1ccccn1

Standard InChI:  InChI=1S/C21H21Cl2N5O4S/c1-14-6-7-16(27(2)19(29)13-28-21(30)20(23)17(22)12-25-28)11-18(14)33(31,32)26-10-8-15-5-3-4-9-24-15/h3-7,9,11-12,26H,8,10,13H2,1-2H3

Standard InChI Key:  HRXJICWTXKACQP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   21.3089   -5.1962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7216   -4.4904    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.9040   -4.4859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4301   -4.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4289   -5.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1370   -6.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8466   -5.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8438   -4.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1352   -4.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7221   -3.6734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5500   -4.4841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2592   -4.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9654   -4.4788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2623   -5.7072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6746   -4.8847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6746   -5.7008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3830   -6.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0902   -5.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0844   -4.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3755   -4.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3687   -3.6546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7891   -4.4602    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.7999   -6.1003    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   22.4300   -3.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4305   -2.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1384   -2.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8440   -2.4522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5515   -2.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5524   -1.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8400   -0.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1354   -1.2277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7209   -6.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5469   -3.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4  2  1  0
  2 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  1  0
 20 21  2  0
 19 22  1  0
 18 23  1  0
 10 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  5 32  1  0
 11 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861803

    ---

Associated Targets(Human)

PRMT5 Tchem PRMT5/MEP50 complex (963 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 510.40Molecular Weight (Monoisotopic): 509.0691AlogP: 2.44#Rotatable Bonds: 8
Polar Surface Area: 114.26Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.19CX Basic pKa: 4.54CX LogP: 1.94CX LogD: 1.94
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -2.46

References

1. McKinney DC, McMillan BJ, Ranaghan MJ, Moroco JA, Brousseau M, Mullin-Bernstein Z, O'Keefe M, McCarren P, Mesleh MF, Mulvaney KM, Robinson F, Singh R, Bajrami B, Wagner FF, Hilgraf R, Drysdale MJ, Campbell AJ, Skepner A, Timm DE, Porter D, Kaushik VK, Sellers WR, Ianari A..  (2021)  Discovery of a First-in-Class Inhibitor of the PRMT5-Substrate Adaptor Interaction.,  64  (15.0): [PMID:34342224] [10.1021/acs.jmedchem.1c00507]

Source