3-(4-ethoxyphenyl)-2-(4-(tetrazolo[1,5-a]quinolin-4-ylmethoxy)phenyl)thiazolidin-4-one

ID: ALA4861809

PubChem CID: 129832256

Max Phase: Preclinical

Molecular Formula: C27H23N5O3S

Molecular Weight: 497.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1ccc(N2C(=O)CSC2c2ccc(OCc3cc4ccccc4n4nnnc34)cc2)cc1

Standard InChI:  InChI=1S/C27H23N5O3S/c1-2-34-22-13-9-21(10-14-22)31-25(33)17-36-27(31)18-7-11-23(12-8-18)35-16-20-15-19-5-3-4-6-24(19)32-26(20)28-29-30-32/h3-15,27H,2,16-17H2,1H3

Standard InChI Key:  LEJMODKYXBEVMZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    4.4042  -18.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2292  -18.2713    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.4861  -17.4871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8167  -17.0004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1517  -17.4871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8155  -16.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5310  -15.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5302  -14.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8145  -14.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0983  -14.9441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1026  -15.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2673  -17.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8796  -17.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6639  -17.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8372  -16.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2199  -16.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4379  -16.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3669  -17.2325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6218  -16.4709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7934  -15.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5781  -15.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7452  -14.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5334  -14.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1442  -14.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9290  -14.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1040  -13.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4882  -13.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7059  -13.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9701  -15.7134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1896  -15.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1901  -16.7884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9710  -17.0416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4530  -16.3771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8122  -13.7010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5254  -13.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5231  -12.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  4  6  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  3 12  1  0
  5 18  2  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 21 30  1  0
 21 22  2  0
 29 24  1  0
 23 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 29  1  0
  9 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861809

    ---

Associated Targets(non-human)

Mycobacterium tuberculosis variant bovis BCG (1626 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.58Molecular Weight (Monoisotopic): 497.1522AlogP: 5.03#Rotatable Bonds: 7
Polar Surface Area: 81.85Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.79CX LogD: 4.79
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.47

References

1. Trotsko N..  (2021)  Antitubercular properties of thiazolidin-4-ones - A review.,  215  [PMID:33588179] [10.1016/j.ejmech.2021.113266]

Source