5-Chloro-N-[4-(7,8-difluoro-[1,2,4]triazolo[4,3-a]quinoxalin-4-yloxy)-phenyl]-2-methoxybenzenesulfonamide

ID: ALA4861819

PubChem CID: 164618039

Max Phase: Preclinical

Molecular Formula: C22H14ClF2N5O4S

Molecular Weight: 517.90

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cl)cc1S(=O)(=O)Nc1ccc(Oc2nc3cc(F)c(F)cc3n3cnnc23)cc1

Standard InChI:  InChI=1S/C22H14ClF2N5O4S/c1-33-19-7-2-12(23)8-20(19)35(31,32)29-13-3-5-14(6-4-13)34-22-21-28-26-11-30(21)18-10-16(25)15(24)9-17(18)27-22/h2-11,29H,1H3

Standard InChI Key:  NYUGDYTWGIYGOI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    9.1624  -18.5436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5752  -19.2535    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.9836  -18.5412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2986  -19.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9937  -19.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7141  -19.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7339  -20.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0388  -20.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3219  -20.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8763  -19.6620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9683  -18.3944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6655  -17.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1644  -19.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4581  -19.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7504  -19.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7448  -18.4467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4511  -18.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1629  -18.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0370  -18.0429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6301  -19.6829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3364  -19.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3307  -18.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6189  -18.0485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9167  -18.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2048  -18.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986  -18.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5042  -19.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2119  -19.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9182  -19.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6132  -20.5627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9466  -19.8131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8022  -20.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0620  -21.6615    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.7882  -18.0635    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.7989  -19.6976    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  2 10  1  0
  4  2  1  0
 11 12  1  0
  5 11  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 20 29  1  0
 24 29  2  0
 30 31  1  0
 30 32  2  0
 20 32  1  0
 21 31  2  0
 19 22  1  0
 16 19  1  0
 10 13  1  0
  8 33  1  0
 26 34  1  0
 27 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861819

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 517.90Molecular Weight (Monoisotopic): 517.0423AlogP: 4.81#Rotatable Bonds: 6
Polar Surface Area: 107.71Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.04CX Basic pKa: 1.57CX LogP: 3.30CX LogD: 2.89
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -2.03

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source