4-Cyano-2-fluoro-N-(4-(N-phenylsulfamoyl)phenyl)benzamide

ID: ALA4861825

PubChem CID: 164618042

Max Phase: Preclinical

Molecular Formula: C20H14FN3O3S

Molecular Weight: 395.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3ccccc3)cc2)c(F)c1

Standard InChI:  InChI=1S/C20H14FN3O3S/c21-19-12-14(13-22)6-11-18(19)20(25)23-15-7-9-17(10-8-15)28(26,27)24-16-4-2-1-3-5-16/h1-12,24H,(H,23,25)

Standard InChI Key:  AFGAZJNDWLABNV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   11.5067   -5.3117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9194   -6.0216    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.3279   -5.3093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3901   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6810   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9719   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2670   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2670   -8.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9719   -8.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6810   -8.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3901   -6.4300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0951   -7.6558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8042   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5133   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2182   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2182   -6.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5133   -6.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8042   -6.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6270   -6.4383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6190   -7.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3240   -7.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3180   -8.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6069   -8.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9019   -8.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9079   -7.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9709   -6.4300    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.5603   -8.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8523   -9.2924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  2  0
  4 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
  2 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 19 20  1  0
 16  2  1  0
 12 13  1  0
  6 26  1  0
 27 28  3  0
  8 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861825

    ---

Associated Targets(Human)

GPR27 Tbio Probable G-protein coupled receptor 27 (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.42Molecular Weight (Monoisotopic): 395.0740AlogP: 3.75#Rotatable Bonds: 5
Polar Surface Area: 99.06Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.94CX Basic pKa: CX LogP: 3.55CX LogD: 3.46
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.69Np Likeness Score: -2.17

References

1. Pillaiyar T, Rosato F, Wozniak M, Blavier J, Charles M, Laschet C, Kronenberger T, Müller CE, Hanson J..  (2021)  Structure-activity relationships of agonists for the orphan G protein-coupled receptor GPR27.,  225  [PMID:34454125] [10.1016/j.ejmech.2021.113777]

Source