The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Benzyl-2-(4-((E)-3,5-dimethoxy-2-((E)-2-nitrovinyl)styryl)phenoxy)acetamide ID: ALA4861925
PubChem CID: 164619511
Max Phase: Preclinical
Molecular Formula: C27H26N2O6
Molecular Weight: 474.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/c2ccc(OCC(=O)NCc3ccccc3)cc2)c(/C=C/[N+](=O)[O-])c(OC)c1
Standard InChI: InChI=1S/C27H26N2O6/c1-33-24-16-22(25(14-15-29(31)32)26(17-24)34-2)11-8-20-9-12-23(13-10-20)35-19-27(30)28-18-21-6-4-3-5-7-21/h3-17H,18-19H2,1-2H3,(H,28,30)/b11-8+,15-14+
Standard InChI Key: YETPQUQOYDYWKN-IIXCLMFLSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
1.1736 -20.9414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1724 -21.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8872 -22.1817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6036 -21.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6008 -20.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8854 -20.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8829 -19.7037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1672 -19.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4576 -22.1808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2602 -21.7676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3188 -22.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0325 -21.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7477 -22.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7443 -23.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4586 -23.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1734 -22.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1694 -22.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4546 -21.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8890 -23.4090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6023 -22.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3180 -23.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3204 -24.2298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0312 -22.9902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7469 -23.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4540 -22.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3137 -20.5227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0297 -20.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7426 -20.5172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7403 -19.6911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4594 -20.9260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1684 -21.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4540 -22.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1684 -23.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8829 -22.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8829 -22.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
2 9 1 0
9 10 1 0
4 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
25 24 1 0
5 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
28 30 1 0
32 25 2 0
25 33 1 0
31 32 1 0
33 34 2 0
34 35 1 0
31 35 2 0
M CHG 2 28 1 30 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.51Molecular Weight (Monoisotopic): 474.1791AlogP: 4.82#Rotatable Bonds: 11Polar Surface Area: 99.93Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.84CX Basic pKa: ┄CX LogP: 4.62CX LogD: 4.62Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -0.48
References 1. Chen LZ, Zhang XX, Liu MM, Wu J, Ma D, Diao LZ, Li Q, Huang YS, Zhang R, Ruan BF, Liu XH.. (2021) Discovery of Novel Pterostilbene-Based Derivatives as Potent and Orally Active NLRP3 Inflammasome Inhibitors with Inflammatory Activity for Colitis., 64 (18.0): [PMID:34506712 ] [10.1021/acs.jmedchem.1c01007 ]