The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-benzyl-3-((2-chloro-4-(trifluoromethyl)phenoxy)methyl)benzamide ID: ALA4861940
PubChem CID: 155154007
Max Phase: Preclinical
Molecular Formula: C22H17ClF3NO2
Molecular Weight: 419.83
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccccc1)c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1
Standard InChI: InChI=1S/C22H17ClF3NO2/c23-19-12-18(22(24,25)26)9-10-20(19)29-14-16-7-4-8-17(11-16)21(28)27-13-15-5-2-1-3-6-15/h1-12H,13-14H2,(H,27,28)
Standard InChI Key: LESMBUJYQBPRGA-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
4.6954 -29.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6942 -30.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4023 -30.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1119 -30.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1091 -29.6257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4005 -29.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8153 -29.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5245 -29.6204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2307 -29.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9383 -29.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6440 -29.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6414 -28.3898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9272 -27.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2244 -28.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5136 -27.9938 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.3470 -27.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0568 -28.3826 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.3428 -27.1605 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0527 -27.5616 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9876 -29.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9874 -28.4037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2800 -29.6297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5721 -29.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8645 -29.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1572 -29.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4501 -29.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4499 -30.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1627 -30.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8669 -30.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
12 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
1 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.83Molecular Weight (Monoisotopic): 419.0900AlogP: 5.87#Rotatable Bonds: 6Polar Surface Area: 38.33Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.82CX LogD: 5.82Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.54Np Likeness Score: -1.51
References 1. (2020) Modulators of mas-related g-protein receptor x4 and related products and methods,