N-benzyl-3-((2-chloro-4-(trifluoromethyl)phenoxy)methyl)benzamide

ID: ALA4861940

PubChem CID: 155154007

Max Phase: Preclinical

Molecular Formula: C22H17ClF3NO2

Molecular Weight: 419.83

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCc1ccccc1)c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1

Standard InChI:  InChI=1S/C22H17ClF3NO2/c23-19-12-18(22(24,25)26)9-10-20(19)29-14-16-7-4-8-17(11-16)21(28)27-13-15-5-2-1-3-6-15/h1-12H,13-14H2,(H,27,28)

Standard InChI Key:  LESMBUJYQBPRGA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    4.6954  -29.6293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6942  -30.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4023  -30.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1119  -30.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1091  -29.6257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4005  -29.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8153  -29.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5245  -29.6204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2307  -29.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9383  -29.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6440  -29.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6414  -28.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9272  -27.9841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2244  -28.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5136  -27.9938    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.3470  -27.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0568  -28.3826    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.3428  -27.1605    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.0527  -27.5616    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9876  -29.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9874  -28.4037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2800  -29.6297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5721  -29.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8645  -29.6300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1572  -29.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4501  -29.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4499  -30.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1627  -30.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8669  -30.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 12 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
  1 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4861940

    ---

Associated Targets(Human)

MRGPRX4 Tchem Mas-related G-protein coupled receptor member X4 (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.83Molecular Weight (Monoisotopic): 419.0900AlogP: 5.87#Rotatable Bonds: 6
Polar Surface Area: 38.33Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.82CX LogD: 5.82
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.54Np Likeness Score: -1.51

References

1.  (2020)  Modulators of mas-related g-protein receptor x4 and related products and methods, 

Source